C26H35ClFN5O — CID 160874777
(2S,6R)-N-[2-(1-benzylpiperidin-4-yl)ethyl]-4-(6-chloro-5-fluoro-3-pyridinyl)-2,6-dimethylpiperazine-1-carboxamide (PubChem CID 160874777) has the molecular formula C26H35ClFN5O and a molecular weight of 488.05 g/mol. Its IUPAC name is (2S,6R)-N-[2-(1-benzylpiperidin-4-yl)ethyl]-4-(6-chloro-5-fluoro-3-pyridinyl)-2,6-dimethylpiperazine-1-carboxamide.
| Compound Name | (2S,6R)-N-[2-(1-benzylpiperidin-4-yl)ethyl]-4-(6-chloro-5-fluoro-3-pyridinyl)-2,6-dimethylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 160874777 |
| Molecular Formula | C26H35ClFN5O |
| Molecular Weight | 488.05 g/mol |
| Exact Mass | 487.25 |
| IUPAC Name | (2S,6R)-N-[2-(1-benzylpiperidin-4-yl)ethyl]-4-(6-chloro-5-fluoro-3-pyridinyl)-2,6-dimethylpiperazine-1-carboxamide |
| SMILES | C[C@@H]1CN(c2cnc(Cl)c(F)c2)C[C@H](C)N1C(=O)NCCC1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C26H35ClFN5O/c1-19-16-32(23-14-24(28)25(27)30-15-23)17-20(2)33(19)26(34)29-11-8-21-9-12-31(13-10-21)18-22-6-4-3-5-7-22/h3-7,14-15,19-21H,8-13,16-18H2,1-2H3,(H,29,34)/t19-,20+ |
| InChIKey | SMFZJNAQVMLPNH-BGYRXZFFSA-N |
| XLogP | 4.78 |
| TPSA | 51.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.05 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|