C19H21ClN6O5 — CID 160875298
methyl N-[5-chloro-2-[1-[2-[[1-(N'-hydroxycarbamimidoyl)cyclopropyl]amino]-2-oxoethyl]-2-methyl-6-oxopyrimidin-4-yl]phenyl]carbamate (PubChem CID 160875298) has the molecular formula C19H21ClN6O5 and a molecular weight of 448.87 g/mol. Its IUPAC name is methyl N-[5-chloro-2-[1-[2-[[1-(N'-hydroxycarbamimidoyl)cyclopropyl]amino]-2-oxoethyl]-2-methyl-6-oxopyrimidin-4-yl]phenyl]carbamate.
| Compound Name | methyl N-[5-chloro-2-[1-[2-[[1-(N'-hydroxycarbamimidoyl)cyclopropyl]amino]-2-oxoethyl]-2-methyl-6-oxopyrimidin-4-yl]phenyl]carbamate |
|---|---|
| PubChem CID | 160875298 |
| Molecular Formula | C19H21ClN6O5 |
| Molecular Weight | 448.87 g/mol |
| Exact Mass | 448.13 |
| IUPAC Name | methyl N-[5-chloro-2-[1-[2-[[1-(N'-hydroxycarbamimidoyl)cyclopropyl]amino]-2-oxoethyl]-2-methyl-6-oxopyrimidin-4-yl]phenyl]carbamate |
| SMILES | COC(=O)Nc1cc(Cl)ccc1-c1cc(=O)n(CC(=O)NC2(C(N)=NO)CC2)c(C)n1 |
| InChI | InChI=1S/C19H21ClN6O5/c1-10-22-14(12-4-3-11(20)7-13(12)23-18(29)31-2)8-16(28)26(10)9-15(27)24-19(5-6-19)17(21)25-30/h3-4,7-8,30H,5-6,9H2,1-2H3,(H2,21,25)(H,23,29)(H,24,27) |
| InChIKey | SMHSWOMOJXJNFW-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 160.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.87 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|