About [(S)-[(2R)-5-fluoro-2,3-dihydro-1H-inden-2-yl]-phenylmethyl] carbamate
[(S)-[(2R)-5-fluoro-2,3-dihydro-1H-inden-2-yl]-phenylmethyl] carbamate (PubChem CID 160876236) has the molecular formula C17H16FNO2
and a molecular weight of 285.32 g/mol. Its IUPAC name is [(S)-[(2R)-5-fluoro-2,3-dihydro-1H-inden-2-yl]-phenylmethyl] carbamate.
Molecular Properties
| Compound Name | [(S)-[(2R)-5-fluoro-2,3-dihydro-1H-inden-2-yl]-phenylmethyl] carbamate |
| PubChem CID | 160876236 |
| Molecular Formula | C17H16FNO2 |
| Molecular Weight | 285.32 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | [(S)-[(2R)-5-fluoro-2,3-dihydro-1H-inden-2-yl]-phenylmethyl] carbamate |
| SMILES | NC(=O)O[C@H](c1ccccc1)[C@@H]1Cc2ccc(F)cc2C1 |
| InChI | InChI=1S/C17H16FNO2/c18-15-7-6-12-8-14(9-13(12)10-15)16(21-17(19)20)11-4-2-1-3-5-11/h1-7,10,14,16H,8-9H2,(H2,19,20)/t14-,16-/m1/s1 |
| InChIKey | SMKUPAZRXKBMCP-GDBMZVCRSA-N |
| XLogP | 3.38 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.32 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [(S)-[(2R)-5-fluoro-2,3-dihydro-1H-inden-2-yl]-phenylmethyl] carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(S)-[(2R)-5-fluoro-2,3-dihydro-1H-inden-2-yl]-phenylmethyl] carbamate?
The IUPAC name of [(S)-[(2R)-5-fluoro-2,3-dihydro-1H-inden-2-yl]-phenylmethyl] carbamate (CID 160876236) is [(S)-[(2R)-5-fluoro-2,3-dihydro-1H-inden-2-yl]-phenylmethyl] carbamate.
What is the SMILES notation for [(S)-[(2R)-5-fluoro-2,3-dihydro-1H-inden-2-yl]-phenylmethyl] carbamate?
The canonical SMILES for [(S)-[(2R)-5-fluoro-2,3-dihydro-1H-inden-2-yl]-phenylmethyl] carbamate is NC(=O)O[C@H](c1ccccc1)[C@@H]1Cc2ccc(F)cc2C1.
What is the InChIKey of [(S)-[(2R)-5-fluoro-2,3-dihydro-1H-inden-2-yl]-phenylmethyl] carbamate?
The InChIKey is SMKUPAZRXKBMCP-GDBMZVCRSA-N. The full InChI is InChI=1S/C17H16FNO2/c18-15-7-6-12-8-14(9-13(12)10-15)16(21-17(19)20)11-4-2-1-3-5-11/h1-7,10,14,16H,8-9H2,(H2,19,20)/t14-,16-/m1/s1.
What are the key properties of [(S)-[(2R)-5-fluoro-2,3-dihydro-1H-inden-2-yl]-phenylmethyl] carbamate?
[(S)-[(2R)-5-fluoro-2,3-dihydro-1H-inden-2-yl]-phenylmethyl] carbamate has a molecular weight of 285.32 g/mol, XLogP of 3.38, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(S)-[(2R)-5-fluoro-2,3-dihydro-1H-inden-2-yl]-phenylmethyl] carbamate is sourced from PubChem (CID 160876236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).