C18H40N2O2 — CID 160876284
(2S,4S)-1-[(E)-but-2-enoyl]-N,4-dimethylpyrrolidine-2-carboxamide;ethane;methane (PubChem CID 160876284) has the molecular formula C18H40N2O2 and a molecular weight of 316.53 g/mol. Its IUPAC name is (2S,4S)-1-[(E)-but-2-enoyl]-N,4-dimethylpyrrolidine-2-carboxamide;ethane;methane.
| Compound Name | (2S,4S)-1-[(E)-but-2-enoyl]-N,4-dimethylpyrrolidine-2-carboxamide;ethane;methane |
|---|---|
| PubChem CID | 160876284 |
| Molecular Formula | C18H40N2O2 |
| Molecular Weight | 316.53 g/mol |
| Exact Mass | 316.31 |
| IUPAC Name | (2S,4S)-1-[(E)-but-2-enoyl]-N,4-dimethylpyrrolidine-2-carboxamide;ethane;methane |
| SMILES | C.C/C=C/C(=O)N1C[C@@H](C)C[C@H]1C(=O)NC.CC.CC.CC |
| InChI | InChI=1S/C11H18N2O2.3C2H6.CH4/c1-4-5-10(14)13-7-8(2)6-9(13)11(15)12-3;3*1-2;/h4-5,8-9H,6-7H2,1-3H3,(H,12,15);3*1-2H3;1H4/b5-4+;;;;/t8-,9-;;;;/m0..../s1 |
| InChIKey | SMKZBOXZIHIZCP-AFFNDPQCSA-N |
| XLogP | 4.26 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.53 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|