C24H48N2O4Si2 — CID 160877263
2-[2-[butyl(dimethyl)silyl]oxypropan-2-yloxy-dimethylsilyl]-N-[3-(isocyanatomethyl)-3,5,5-trimethylcyclohexyl]acetamide (PubChem CID 160877263) has the molecular formula C24H48N2O4Si2 and a molecular weight of 484.83 g/mol. Its IUPAC name is 2-[2-[butyl(dimethyl)silyl]oxypropan-2-yloxy-dimethylsilyl]-N-[3-(isocyanatomethyl)-3,5,5-trimethylcyclohexyl]acetamide.
| Compound Name | 2-[2-[butyl(dimethyl)silyl]oxypropan-2-yloxy-dimethylsilyl]-N-[3-(isocyanatomethyl)-3,5,5-trimethylcyclohexyl]acetamide |
|---|---|
| PubChem CID | 160877263 |
| Molecular Formula | C24H48N2O4Si2 |
| Molecular Weight | 484.83 g/mol |
| Exact Mass | 484.32 |
| IUPAC Name | 2-[2-[butyl(dimethyl)silyl]oxypropan-2-yloxy-dimethylsilyl]-N-[3-(isocyanatomethyl)-3,5,5-trimethylcyclohexyl]acetamide |
| SMILES | CCCC[Si](C)(C)OC(C)(C)O[Si](C)(C)CC(=O)NC1CC(C)(C)CC(C)(CN=C=O)C1 |
| InChI | InChI=1S/C24H48N2O4Si2/c1-11-12-13-31(7,8)29-23(4,5)30-32(9,10)16-21(28)26-20-14-22(2,3)17-24(6,15-20)18-25-19-27/h20H,11-18H2,1-10H3,(H,26,28) |
| InChIKey | KQMZHTVGQHGACW-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.83 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|