C26H27ClF7N3O3 — CID 160877988
acetyl chloride;1-[(3R,4R)-1-acetyl-3-(4-fluorophenyl)piperidin-4-yl]-3-[3,5-bis(trifluoromethyl)phenyl]-1,3-dimethylurea (PubChem CID 160877988) has the molecular formula C26H27ClF7N3O3 and a molecular weight of 597.96 g/mol. Its IUPAC name is acetyl chloride;1-[(3R,4R)-1-acetyl-3-(4-fluorophenyl)piperidin-4-yl]-3-[3,5-bis(trifluoromethyl)phenyl]-1,3-dimethylurea.
| Compound Name | acetyl chloride;1-[(3R,4R)-1-acetyl-3-(4-fluorophenyl)piperidin-4-yl]-3-[3,5-bis(trifluoromethyl)phenyl]-1,3-dimethylurea |
|---|---|
| PubChem CID | 160877988 |
| Molecular Formula | C26H27ClF7N3O3 |
| Molecular Weight | 597.96 g/mol |
| Exact Mass | 597.16 |
| IUPAC Name | acetyl chloride;1-[(3R,4R)-1-acetyl-3-(4-fluorophenyl)piperidin-4-yl]-3-[3,5-bis(trifluoromethyl)phenyl]-1,3-dimethylurea |
| SMILES | CC(=O)Cl.CC(=O)N1CC[C@@H](N(C)C(=O)N(C)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)[C@H](c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C24H24F7N3O2.C2H3ClO/c1-14(35)34-9-8-21(20(13-34)15-4-6-18(25)7-5-15)33(3)22(36)32(2)19-11-16(23(26,27)28)10-17(12-19)24(29,30)31;1-2(3)4/h4-7,10-12,20-21H,8-9,13H2,1-3H3;1H3/t20-,21+;/m0./s1 |
| InChIKey | SMQPXBFCEYZGQV-JUDYQFGCSA-N |
| XLogP | 6.53 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.96 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|