C23H42N2O4 — CID 160878608
N,N'-bis(2-methylcyclohexyl)methanediamine;diethyl (Z)-but-2-enedioate (PubChem CID 160878608) has the molecular formula C23H42N2O4 and a molecular weight of 410.60 g/mol. Its IUPAC name is N,N'-bis(2-methylcyclohexyl)methanediamine;diethyl (Z)-but-2-enedioate.
| Compound Name | N,N'-bis(2-methylcyclohexyl)methanediamine;diethyl (Z)-but-2-enedioate |
|---|---|
| PubChem CID | 160878608 |
| Molecular Formula | C23H42N2O4 |
| Molecular Weight | 410.60 g/mol |
| Exact Mass | 410.31 |
| IUPAC Name | N,N'-bis(2-methylcyclohexyl)methanediamine;diethyl (Z)-but-2-enedioate |
| SMILES | CC1CCCCC1NCNC1CCCCC1C.CCOC(=O)/C=C\C(=O)OCC |
| InChI | InChI=1S/C15H30N2.C8H12O4/c1-12-7-3-5-9-14(12)16-11-17-15-10-6-4-8-13(15)2;1-3-11-7(9)5-6-8(10)12-4-2/h12-17H,3-11H2,1-2H3;5-6H,3-4H2,1-2H3/b;6-5- |
| InChIKey | SMSQEXAQNMWLIV-JXGYXAOLSA-N |
| XLogP | 3.95 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.60 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|