About 2-methoxybenzoic acid;2-methylsulfonylbenzoic acid;2-(trifluoromethoxy)benzoic acid
2-methoxybenzoic acid;2-methylsulfonylbenzoic acid;2-(trifluoromethoxy)benzoic acid (PubChem CID 160878825) has the molecular formula C24H21F3O10S
and a molecular weight of 558.48 g/mol. Its IUPAC name is 2-methoxybenzoic acid;2-methylsulfonylbenzoic acid;2-(trifluoromethoxy)benzoic acid.
Molecular Properties
| Compound Name | 2-methoxybenzoic acid;2-methylsulfonylbenzoic acid;2-(trifluoromethoxy)benzoic acid |
| PubChem CID | 160878825 |
| Molecular Formula | C24H21F3O10S |
| Molecular Weight | 558.48 g/mol |
| Exact Mass | 558.08 |
| IUPAC Name | 2-methoxybenzoic acid;2-methylsulfonylbenzoic acid;2-(trifluoromethoxy)benzoic acid |
| SMILES | COc1ccccc1C(=O)O.CS(=O)(=O)c1ccccc1C(=O)O.O=C(O)c1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C8H5F3O3.C8H8O4S.C8H8O3/c9-8(10,11)14-6-4-2-1-3-5(6)7(12)13;1-13(11,12)7-5-3-2-4-6(7)8(9)10;1-11-7-5-3-2-4-6(7)8(9)10/h1-4H,(H,12,13);2-5H,1H3,(H,9,10);2-5H,1H3,(H,9,10) |
| InChIKey | SMTLBUPWPHXCHI-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 164.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 558.48 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-methoxybenzoic acid;2-methylsulfonylbenzoic acid;2-(trifluoromethoxy)benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxybenzoic acid;2-methylsulfonylbenzoic acid;2-(trifluoromethoxy)benzoic acid?
The IUPAC name of 2-methoxybenzoic acid;2-methylsulfonylbenzoic acid;2-(trifluoromethoxy)benzoic acid (CID 160878825) is 2-methoxybenzoic acid;2-methylsulfonylbenzoic acid;2-(trifluoromethoxy)benzoic acid.
What is the SMILES notation for 2-methoxybenzoic acid;2-methylsulfonylbenzoic acid;2-(trifluoromethoxy)benzoic acid?
The canonical SMILES for 2-methoxybenzoic acid;2-methylsulfonylbenzoic acid;2-(trifluoromethoxy)benzoic acid is COc1ccccc1C(=O)O.CS(=O)(=O)c1ccccc1C(=O)O.O=C(O)c1ccccc1OC(F)(F)F.
What is the InChIKey of 2-methoxybenzoic acid;2-methylsulfonylbenzoic acid;2-(trifluoromethoxy)benzoic acid?
The InChIKey is SMTLBUPWPHXCHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5F3O3.C8H8O4S.C8H8O3/c9-8(10,11)14-6-4-2-1-3-5(6)7(12)13;1-13(11,12)7-5-3-2-4-6(7)8(9)10;1-11-7-5-3-2-4-6(7)8(9)10/h1-4H,(H,12,13);2-5H,1H3,(H,9,10);2-5H,1H3,(H,9,10).
What are the key properties of 2-methoxybenzoic acid;2-methylsulfonylbenzoic acid;2-(trifluoromethoxy)benzoic acid?
2-methoxybenzoic acid;2-methylsulfonylbenzoic acid;2-(trifluoromethoxy)benzoic acid has a molecular weight of 558.48 g/mol, XLogP of 4.47, 6 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxybenzoic acid;2-methylsulfonylbenzoic acid;2-(trifluoromethoxy)benzoic acid is sourced from PubChem (CID 160878825), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).