C34H33Cl2IN4O6 — CID 160880234
ethyl 2-[7-(3-chlorophenyl)-6-iodo-1-oxo-3,4-dihydro-2H-pyrrolo[1,2-a]pyrazin-4-yl]acetate;ethyl 2-[7-(3-chlorophenyl)-1-oxo-3,4-dihydro-2H-pyrrolo[1,2-a]pyrazin-4-yl]acetate (PubChem CID 160880234) has the molecular formula C34H33Cl2IN4O6 and a molecular weight of 791.47 g/mol. Its IUPAC name is ethyl 2-[7-(3-chlorophenyl)-6-iodo-1-oxo-3,4-dihydro-2H-pyrrolo[1,2-a]pyrazin-4-yl]acetate;ethyl 2-[7-(3-chlorophenyl)-1-oxo-3,4-dihydro-2H-pyrrolo[1,2-a]pyrazin-4-yl]acetate.
| Compound Name | ethyl 2-[7-(3-chlorophenyl)-6-iodo-1-oxo-3,4-dihydro-2H-pyrrolo[1,2-a]pyrazin-4-yl]acetate;ethyl 2-[7-(3-chlorophenyl)-1-oxo-3,4-dihydro-2H-pyrrolo[1,2-a]pyrazin-4-yl]acetate |
|---|---|
| PubChem CID | 160880234 |
| Molecular Formula | C34H33Cl2IN4O6 |
| Molecular Weight | 791.47 g/mol |
| Exact Mass | 790.08 |
| IUPAC Name | ethyl 2-[7-(3-chlorophenyl)-6-iodo-1-oxo-3,4-dihydro-2H-pyrrolo[1,2-a]pyrazin-4-yl]acetate;ethyl 2-[7-(3-chlorophenyl)-1-oxo-3,4-dihydro-2H-pyrrolo[1,2-a]pyrazin-4-yl]acetate |
| SMILES | CCOC(=O)CC1CNC(=O)c2cc(-c3cccc(Cl)c3)c(I)n21.CCOC(=O)CC1CNC(=O)c2cc(-c3cccc(Cl)c3)cn21 |
| InChI | InChI=1S/C17H16ClIN2O3.C17H17ClN2O3/c1-2-24-15(22)7-12-9-20-17(23)14-8-13(16(19)21(12)14)10-4-3-5-11(18)6-10;1-2-23-16(21)8-14-9-19-17(22)15-7-12(10-20(14)15)11-4-3-5-13(18)6-11/h3-6,8,12H,2,7,9H2,1H3,(H,20,23);3-7,10,14H,2,8-9H2,1H3,(H,19,22) |
| InChIKey | SMXXCGSWRQIEPO-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 120.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 791.47 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|