About 1-(4,4-diethylhexoxy)-2,5-diethyl-4-(2-fluoro-4-methylphenyl)benzene
1-(4,4-diethylhexoxy)-2,5-diethyl-4-(2-fluoro-4-methylphenyl)benzene (PubChem CID 160881796) has the molecular formula C27H39FO
and a molecular weight of 398.61 g/mol. Its IUPAC name is 1-(4,4-diethylhexoxy)-2,5-diethyl-4-(2-fluoro-4-methylphenyl)benzene.
Molecular Properties
| Compound Name | 1-(4,4-diethylhexoxy)-2,5-diethyl-4-(2-fluoro-4-methylphenyl)benzene |
| PubChem CID | 160881796 |
| Molecular Formula | C27H39FO |
| Molecular Weight | 398.61 g/mol |
| Exact Mass | 398.30 |
| IUPAC Name | 1-(4,4-diethylhexoxy)-2,5-diethyl-4-(2-fluoro-4-methylphenyl)benzene |
| SMILES | CCc1cc(-c2ccc(C)cc2F)c(CC)cc1OCCCC(CC)(CC)CC |
| InChI | InChI=1S/C27H39FO/c1-7-21-19-26(29-16-12-15-27(9-3,10-4)11-5)22(8-2)18-24(21)23-14-13-20(6)17-25(23)28/h13-14,17-19H,7-12,15-16H2,1-6H3 |
| InChIKey | ANMKXXNATKMBOJ-UHFFFAOYSA-N |
| XLogP | 8.30 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 398.61 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-(4,4-diethylhexoxy)-2,5-diethyl-4-(2-fluoro-4-methylphenyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4,4-diethylhexoxy)-2,5-diethyl-4-(2-fluoro-4-methylphenyl)benzene?
The IUPAC name of 1-(4,4-diethylhexoxy)-2,5-diethyl-4-(2-fluoro-4-methylphenyl)benzene (CID 160881796) is 1-(4,4-diethylhexoxy)-2,5-diethyl-4-(2-fluoro-4-methylphenyl)benzene.
What is the SMILES notation for 1-(4,4-diethylhexoxy)-2,5-diethyl-4-(2-fluoro-4-methylphenyl)benzene?
The canonical SMILES for 1-(4,4-diethylhexoxy)-2,5-diethyl-4-(2-fluoro-4-methylphenyl)benzene is CCc1cc(-c2ccc(C)cc2F)c(CC)cc1OCCCC(CC)(CC)CC.
What is the InChIKey of 1-(4,4-diethylhexoxy)-2,5-diethyl-4-(2-fluoro-4-methylphenyl)benzene?
The InChIKey is ANMKXXNATKMBOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H39FO/c1-7-21-19-26(29-16-12-15-27(9-3,10-4)11-5)22(8-2)18-24(21)23-14-13-20(6)17-25(23)28/h13-14,17-19H,7-12,15-16H2,1-6H3.
What are the key properties of 1-(4,4-diethylhexoxy)-2,5-diethyl-4-(2-fluoro-4-methylphenyl)benzene?
1-(4,4-diethylhexoxy)-2,5-diethyl-4-(2-fluoro-4-methylphenyl)benzene has a molecular weight of 398.61 g/mol, XLogP of 8.30, 11 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4,4-diethylhexoxy)-2,5-diethyl-4-(2-fluoro-4-methylphenyl)benzene is sourced from PubChem (CID 160881796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).