C24H28N4O4 — CID 160883322
acetic acid;(1R)-9-(cyclobutylamino)-1-methyl-8-(2-methylphenyl)-3,5-dihydro-1H-[1,2,4]triazino[3,4-c][1,4]benzoxazin-2-one (PubChem CID 160883322) has the molecular formula C24H28N4O4 and a molecular weight of 436.51 g/mol. Its IUPAC name is acetic acid;(1R)-9-(cyclobutylamino)-1-methyl-8-(2-methylphenyl)-3,5-dihydro-1H-[1,2,4]triazino[3,4-c][1,4]benzoxazin-2-one.
| Compound Name | acetic acid;(1R)-9-(cyclobutylamino)-1-methyl-8-(2-methylphenyl)-3,5-dihydro-1H-[1,2,4]triazino[3,4-c][1,4]benzoxazin-2-one |
|---|---|
| PubChem CID | 160883322 |
| Molecular Formula | C24H28N4O4 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.21 |
| IUPAC Name | acetic acid;(1R)-9-(cyclobutylamino)-1-methyl-8-(2-methylphenyl)-3,5-dihydro-1H-[1,2,4]triazino[3,4-c][1,4]benzoxazin-2-one |
| SMILES | CC(=O)O.Cc1ccccc1-c1cc2c(cc1NC1CCC1)N1C(=NNC(=O)[C@H]1C)CO2 |
| InChI | InChI=1S/C22H24N4O2.C2H4O2/c1-13-6-3-4-9-16(13)17-10-20-19(11-18(17)23-15-7-5-8-15)26-14(2)22(27)25-24-21(26)12-28-20;1-2(3)4/h3-4,6,9-11,14-15,23H,5,7-8,12H2,1-2H3,(H,25,27);1H3,(H,3,4)/t14-;/m1./s1 |
| InChIKey | AOKPOZOPZINUTQ-PFEQFJNWSA-N |
| XLogP | 3.75 |
| TPSA | 103.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|