C10H16ClNO — CID 160883545
(1S,2S)-1-amino-1-(1-chlorocyclohexa-2,4-dien-1-yl)butan-2-ol (PubChem CID 160883545) has the molecular formula C10H16ClNO and a molecular weight of 201.70 g/mol. Its IUPAC name is (1S,2S)-1-amino-1-(1-chlorocyclohexa-2,4-dien-1-yl)butan-2-ol.
| Compound Name | (1S,2S)-1-amino-1-(1-chlorocyclohexa-2,4-dien-1-yl)butan-2-ol |
|---|---|
| PubChem CID | 160883545 |
| Molecular Formula | C10H16ClNO |
| Molecular Weight | 201.70 g/mol |
| Exact Mass | 201.09 |
| IUPAC Name | (1S,2S)-1-amino-1-(1-chlorocyclohexa-2,4-dien-1-yl)butan-2-ol |
| SMILES | CC[C@H](O)[C@H](N)C1(Cl)C=CC=CC1 |
| InChI | InChI=1S/C10H16ClNO/c1-2-8(13)9(12)10(11)6-4-3-5-7-10/h3-6,8-9,13H,2,7,12H2,1H3/t8-,9-,10?/m0/s1 |
| InChIKey | SNIMCWQLYNSAPI-XMCUXHSSSA-N |
| XLogP | 1.58 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.70 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|