C36H26N2O7 — CID 160883730
2-hydroxy-5-(naphthalene-2-carbonylamino)benzoic acid;4-(naphthalene-1-carbonylamino)benzoic acid (PubChem CID 160883730) has the molecular formula C36H26N2O7 and a molecular weight of 598.61 g/mol. Its IUPAC name is 2-hydroxy-5-(naphthalene-2-carbonylamino)benzoic acid;4-(naphthalene-1-carbonylamino)benzoic acid.
| Compound Name | 2-hydroxy-5-(naphthalene-2-carbonylamino)benzoic acid;4-(naphthalene-1-carbonylamino)benzoic acid |
|---|---|
| PubChem CID | 160883730 |
| Molecular Formula | C36H26N2O7 |
| Molecular Weight | 598.61 g/mol |
| Exact Mass | 598.17 |
| IUPAC Name | 2-hydroxy-5-(naphthalene-2-carbonylamino)benzoic acid;4-(naphthalene-1-carbonylamino)benzoic acid |
| SMILES | O=C(Nc1ccc(O)c(C(=O)O)c1)c1ccc2ccccc2c1.O=C(O)c1ccc(NC(=O)c2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C18H13NO4.C18H13NO3/c20-16-8-7-14(10-15(16)18(22)23)19-17(21)13-6-5-11-3-1-2-4-12(11)9-13;20-17(19-14-10-8-13(9-11-14)18(21)22)16-7-3-5-12-4-1-2-6-15(12)16/h1-10,20H,(H,19,21)(H,22,23);1-11H,(H,19,20)(H,21,22) |
| InChIKey | SNJBAOBOTPPXAD-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 153.03 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.61 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|