C30H38BrClN2Si2 — CID 160884489
5-bromo-4-methyl-2-(2,3,4,5,6-pentadeuteriophenyl)pyridine;chloro(trimethyl)silane;trimethyl-[4-methyl-6-(2,3,4,5,6-pentadeuteriophenyl)-3-pyridinyl]silane (PubChem CID 160884489) has the molecular formula C30H38BrClN2Si2 and a molecular weight of 608.24 g/mol. Its IUPAC name is 5-bromo-4-methyl-2-(2,3,4,5,6-pentadeuteriophenyl)pyridine;chloro(trimethyl)silane;trimethyl-[4-methyl-6-(2,3,4,5,6-pentadeuteriophenyl)-3-pyridinyl]silane.
| Compound Name | 5-bromo-4-methyl-2-(2,3,4,5,6-pentadeuteriophenyl)pyridine;chloro(trimethyl)silane;trimethyl-[4-methyl-6-(2,3,4,5,6-pentadeuteriophenyl)-3-pyridinyl]silane |
|---|---|
| PubChem CID | 160884489 |
| Molecular Formula | C30H38BrClN2Si2 |
| Molecular Weight | 608.24 g/mol |
| Exact Mass | 606.21 |
| IUPAC Name | 5-bromo-4-methyl-2-(2,3,4,5,6-pentadeuteriophenyl)pyridine;chloro(trimethyl)silane;trimethyl-[4-methyl-6-(2,3,4,5,6-pentadeuteriophenyl)-3-pyridinyl]silane |
| SMILES | C[Si](C)(C)Cl.[2H]c1c([2H])c([2H])c(-c2cc(C)c(Br)cn2)c([2H])c1[2H].[2H]c1c([2H])c([2H])c(-c2cc(C)c([Si](C)(C)C)cn2)c([2H])c1[2H] |
| InChI | InChI=1S/C15H19NSi.C12H10BrN.C3H9ClSi/c1-12-10-14(13-8-6-5-7-9-13)16-11-15(12)17(2,3)4;1-9-7-12(14-8-11(9)13)10-5-3-2-4-6-10;1-5(2,3)4/h5-11H,1-4H3;2-8H,1H3;1-3H3/i5D,6D,7D,8D,9D;2D,3D,4D,5D,6D; |
| InChIKey | SNLMMDQWGLNNQN-JKSLTCBDSA-N |
| XLogP | 9.48 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.24 |
| LogP ≤ 5 | 9.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|