About methyl-(3-propan-2-ylphenoxy)phosphinic acid;3-propan-2-ylphenol
methyl-(3-propan-2-ylphenoxy)phosphinic acid;3-propan-2-ylphenol (PubChem CID 160884508) has the molecular formula C19H27O4P
and a molecular weight of 350.40 g/mol. Its IUPAC name is methyl-(3-propan-2-ylphenoxy)phosphinic acid;3-propan-2-ylphenol.
Molecular Properties
| Compound Name | methyl-(3-propan-2-ylphenoxy)phosphinic acid;3-propan-2-ylphenol |
| PubChem CID | 160884508 |
| Molecular Formula | C19H27O4P |
| Molecular Weight | 350.40 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | methyl-(3-propan-2-ylphenoxy)phosphinic acid;3-propan-2-ylphenol |
| SMILES | CC(C)c1cccc(O)c1.CC(C)c1cccc(OP(C)(=O)O)c1 |
| InChI | InChI=1S/C10H15O3P.C9H12O/c1-8(2)9-5-4-6-10(7-9)13-14(3,11)12;1-7(2)8-4-3-5-9(10)6-8/h4-8H,1-3H3,(H,11,12);3-7,10H,1-2H3 |
| InChIKey | SNLNPWUZASLBRR-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 350.40 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze methyl-(3-propan-2-ylphenoxy)phosphinic acid;3-propan-2-ylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl-(3-propan-2-ylphenoxy)phosphinic acid;3-propan-2-ylphenol?
The IUPAC name of methyl-(3-propan-2-ylphenoxy)phosphinic acid;3-propan-2-ylphenol (CID 160884508) is methyl-(3-propan-2-ylphenoxy)phosphinic acid;3-propan-2-ylphenol.
What is the SMILES notation for methyl-(3-propan-2-ylphenoxy)phosphinic acid;3-propan-2-ylphenol?
The canonical SMILES for methyl-(3-propan-2-ylphenoxy)phosphinic acid;3-propan-2-ylphenol is CC(C)c1cccc(O)c1.CC(C)c1cccc(OP(C)(=O)O)c1.
What is the InChIKey of methyl-(3-propan-2-ylphenoxy)phosphinic acid;3-propan-2-ylphenol?
The InChIKey is SNLNPWUZASLBRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15O3P.C9H12O/c1-8(2)9-5-4-6-10(7-9)13-14(3,11)12;1-7(2)8-4-3-5-9(10)6-8/h4-8H,1-3H3,(H,11,12);3-7,10H,1-2H3.
What are the key properties of methyl-(3-propan-2-ylphenoxy)phosphinic acid;3-propan-2-ylphenol?
methyl-(3-propan-2-ylphenoxy)phosphinic acid;3-propan-2-ylphenol has a molecular weight of 350.40 g/mol, XLogP of 5.52, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl-(3-propan-2-ylphenoxy)phosphinic acid;3-propan-2-ylphenol is sourced from PubChem (CID 160884508), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).