C21H46F3N3 — CID 160886122
N-tert-butylbutan-1-amine;2-methyl-N-prop-2-enylpropan-2-amine;2-methyl-N-(2,2,2-trifluoroethyl)propan-2-amine (PubChem CID 160886122) has the molecular formula C21H46F3N3 and a molecular weight of 397.61 g/mol. Its IUPAC name is N-tert-butylbutan-1-amine;2-methyl-N-prop-2-enylpropan-2-amine;2-methyl-N-(2,2,2-trifluoroethyl)propan-2-amine.
| Compound Name | N-tert-butylbutan-1-amine;2-methyl-N-prop-2-enylpropan-2-amine;2-methyl-N-(2,2,2-trifluoroethyl)propan-2-amine |
|---|---|
| PubChem CID | 160886122 |
| Molecular Formula | C21H46F3N3 |
| Molecular Weight | 397.61 g/mol |
| Exact Mass | 397.36 |
| IUPAC Name | N-tert-butylbutan-1-amine;2-methyl-N-prop-2-enylpropan-2-amine;2-methyl-N-(2,2,2-trifluoroethyl)propan-2-amine |
| SMILES | C=CCNC(C)(C)C.CC(C)(C)NCC(F)(F)F.CCCCNC(C)(C)C |
| InChI | InChI=1S/C8H19N.C7H15N.C6H12F3N/c1-5-6-7-9-8(2,3)4;1-5-6-8-7(2,3)4;1-5(2,3)10-4-6(7,8)9/h9H,5-7H2,1-4H3;5,8H,1,6H2,2-4H3;10H,4H2,1-3H3 |
| InChIKey | SNQRZMPKJZDRIN-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.61 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|