C28H24O10 — CID 160888115
5-hydroxy-4,8-dimethyl-7,8-dihydropyrano[3,2-g]chromene-2,6-dione;5-hydroxy-4,8-dimethyl-8,9-dihydropyrano[2,3-h]chromene-2,10-dione (PubChem CID 160888115) has the molecular formula C28H24O10 and a molecular weight of 520.49 g/mol. Its IUPAC name is 5-hydroxy-4,8-dimethyl-7,8-dihydropyrano[3,2-g]chromene-2,6-dione;5-hydroxy-4,8-dimethyl-8,9-dihydropyrano[2,3-h]chromene-2,10-dione.
| Compound Name | 5-hydroxy-4,8-dimethyl-7,8-dihydropyrano[3,2-g]chromene-2,6-dione;5-hydroxy-4,8-dimethyl-8,9-dihydropyrano[2,3-h]chromene-2,10-dione |
|---|---|
| PubChem CID | 160888115 |
| Molecular Formula | C28H24O10 |
| Molecular Weight | 520.49 g/mol |
| Exact Mass | 520.14 |
| IUPAC Name | 5-hydroxy-4,8-dimethyl-7,8-dihydropyrano[3,2-g]chromene-2,6-dione;5-hydroxy-4,8-dimethyl-8,9-dihydropyrano[2,3-h]chromene-2,10-dione |
| SMILES | Cc1cc(=O)oc2c3c(cc(O)c12)OC(C)CC3=O.Cc1cc(=O)oc2cc3c(c(O)c12)C(=O)CC(C)O3 |
| InChI | InChI=1S/2C14H12O5/c1-6-3-11(16)19-9-5-10-13(14(17)12(6)9)8(15)4-7(2)18-10;1-6-3-11(17)19-14-12(6)9(16)5-10-13(14)8(15)4-7(2)18-10/h3,5,7,17H,4H2,1-2H3;3,5,7,16H,4H2,1-2H3 |
| InChIKey | SNXGILOVNRNULA-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 153.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.49 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|