C18H20F5N3OS — CID 160888347
1-[(1E,3E)-4-ethylsulfanyl-2-(1,1,2,2,2-pentafluoroethyl)buta-1,3-dienyl]imino-3-[5-methyl-2-(methylamino)-3-pyridinyl]propan-2-one (PubChem CID 160888347) has the molecular formula C18H20F5N3OS and a molecular weight of 421.44 g/mol. Its IUPAC name is 1-[(1E,3E)-4-ethylsulfanyl-2-(1,1,2,2,2-pentafluoroethyl)buta-1,3-dienyl]imino-3-[5-methyl-2-(methylamino)-3-pyridinyl]propan-2-one.
| Compound Name | 1-[(1E,3E)-4-ethylsulfanyl-2-(1,1,2,2,2-pentafluoroethyl)buta-1,3-dienyl]imino-3-[5-methyl-2-(methylamino)-3-pyridinyl]propan-2-one |
|---|---|
| PubChem CID | 160888347 |
| Molecular Formula | C18H20F5N3OS |
| Molecular Weight | 421.44 g/mol |
| Exact Mass | 421.12 |
| IUPAC Name | 1-[(1E,3E)-4-ethylsulfanyl-2-(1,1,2,2,2-pentafluoroethyl)buta-1,3-dienyl]imino-3-[5-methyl-2-(methylamino)-3-pyridinyl]propan-2-one |
| SMILES | CCS/C=C/C(=C\N=C\C(=O)Cc1cc(C)cnc1NC)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C18H20F5N3OS/c1-4-28-6-5-14(17(19,20)18(21,22)23)10-25-11-15(27)8-13-7-12(2)9-26-16(13)24-3/h5-7,9-11H,4,8H2,1-3H3,(H,24,26)/b6-5+,14-10+,25-11+ |
| InChIKey | SNXYOHNBJQJXIK-QQZBLFLRSA-N |
| XLogP | 4.96 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.44 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|