C24H24Cl2FN3O2 — CID 160890101
2-chloro-6-(cyclopropylmethoxy)pyridine;2-chloro-4-[6-(cyclopropylmethoxy)-2-pyridinyl]-6-fluoroaniline (PubChem CID 160890101) has the molecular formula C24H24Cl2FN3O2 and a molecular weight of 476.38 g/mol. Its IUPAC name is 2-chloro-6-(cyclopropylmethoxy)pyridine;2-chloro-4-[6-(cyclopropylmethoxy)-2-pyridinyl]-6-fluoroaniline.
| Compound Name | 2-chloro-6-(cyclopropylmethoxy)pyridine;2-chloro-4-[6-(cyclopropylmethoxy)-2-pyridinyl]-6-fluoroaniline |
|---|---|
| PubChem CID | 160890101 |
| Molecular Formula | C24H24Cl2FN3O2 |
| Molecular Weight | 476.38 g/mol |
| Exact Mass | 475.12 |
| IUPAC Name | 2-chloro-6-(cyclopropylmethoxy)pyridine;2-chloro-4-[6-(cyclopropylmethoxy)-2-pyridinyl]-6-fluoroaniline |
| SMILES | Clc1cccc(OCC2CC2)n1.Nc1c(F)cc(-c2cccc(OCC3CC3)n2)cc1Cl |
| InChI | InChI=1S/C15H14ClFN2O.C9H10ClNO/c16-11-6-10(7-12(17)15(11)18)13-2-1-3-14(19-13)20-8-9-4-5-9;10-8-2-1-3-9(11-8)12-6-7-4-5-7/h1-3,6-7,9H,4-5,8,18H2;1-3,7H,4-6H2 |
| InChIKey | SODPJBQNGPXJPJ-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 70.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.38 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|