C16H24NO4S3+ — CID 160892857
1,4-dithiane-2,5-diol;methyl-methylidene-[(E)-3-oxobut-1-enyl]azanium;1-thiophen-3-ylethanone (PubChem CID 160892857) has the molecular formula C16H24NO4S3+ and a molecular weight of 390.57 g/mol. Its IUPAC name is 1,4-dithiane-2,5-diol;methyl-methylidene-[(E)-3-oxobut-1-enyl]azanium;1-thiophen-3-ylethanone.
| Compound Name | 1,4-dithiane-2,5-diol;methyl-methylidene-[(E)-3-oxobut-1-enyl]azanium;1-thiophen-3-ylethanone |
|---|---|
| PubChem CID | 160892857 |
| Molecular Formula | C16H24NO4S3+ |
| Molecular Weight | 390.57 g/mol |
| Exact Mass | 390.09 |
| IUPAC Name | 1,4-dithiane-2,5-diol;methyl-methylidene-[(E)-3-oxobut-1-enyl]azanium;1-thiophen-3-ylethanone |
| SMILES | C=[N+](C)/C=C/C(C)=O.CC(=O)c1ccsc1.OC1CSC(O)CS1 |
| InChI | InChI=1S/C6H10NO.C6H6OS.C4H8O2S2/c1-6(8)4-5-7(2)3;1-5(7)6-2-3-8-4-6;5-3-1-7-4(6)2-8-3/h4-5H,2H2,1,3H3;2-4H,1H3;3-6H,1-2H2/q+1;;/b5-4+;; |
| InChIKey | SOMPALAZMYGYJK-SFKRKKMESA-N |
| XLogP | 2.49 |
| TPSA | 77.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.57 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|