C23H31N3O2S — CID 160894276
3-[4-[3-(2-methylphenothiazin-10-yl)propyl]piperazin-1-yl]propane-1,2-diol (PubChem CID 160894276) has the molecular formula C23H31N3O2S and a molecular weight of 413.59 g/mol. Its IUPAC name is 3-[4-[3-(2-methylphenothiazin-10-yl)propyl]piperazin-1-yl]propane-1,2-diol.
| Compound Name | 3-[4-[3-(2-methylphenothiazin-10-yl)propyl]piperazin-1-yl]propane-1,2-diol |
|---|---|
| PubChem CID | 160894276 |
| Molecular Formula | C23H31N3O2S |
| Molecular Weight | 413.59 g/mol |
| Exact Mass | 413.21 |
| IUPAC Name | 3-[4-[3-(2-methylphenothiazin-10-yl)propyl]piperazin-1-yl]propane-1,2-diol |
| SMILES | Cc1ccc2c(c1)N(CCCN1CCN(CC(O)CO)CC1)c1ccccc1S2 |
| InChI | InChI=1S/C23H31N3O2S/c1-18-7-8-23-21(15-18)26(20-5-2-3-6-22(20)29-23)10-4-9-24-11-13-25(14-12-24)16-19(28)17-27/h2-3,5-8,15,19,27-28H,4,9-14,16-17H2,1H3 |
| InChIKey | SOQXYIKJGUIFDX-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 50.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.59 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |