C12H25FOSi — CID 160894551
tert-butyl-[(1R,2S)-2-fluorocyclohexyl]oxy-dimethylsilane (PubChem CID 160894551) has the molecular formula C12H25FOSi and a molecular weight of 232.41 g/mol. Its IUPAC name is tert-butyl-[(1R,2S)-2-fluorocyclohexyl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(1R,2S)-2-fluorocyclohexyl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 160894551 |
| Molecular Formula | C12H25FOSi |
| Molecular Weight | 232.41 g/mol |
| Exact Mass | 232.17 |
| IUPAC Name | tert-butyl-[(1R,2S)-2-fluorocyclohexyl]oxy-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1CCCC[C@@H]1F |
| InChI | InChI=1S/C12H25FOSi/c1-12(2,3)15(4,5)14-11-9-7-6-8-10(11)13/h10-11H,6-9H2,1-5H3/t10-,11+/m0/s1 |
| InChIKey | SORVIHDGWAAULE-WDEREUQCSA-N |
| XLogP | 4.29 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.41 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|