About aniline;1-benzyl-3-chlorobenzene;1-bromo-3-chlorobenzene
aniline;1-benzyl-3-chlorobenzene;1-bromo-3-chlorobenzene (PubChem CID 160894859) has the molecular formula C25H22BrCl2N
and a molecular weight of 487.27 g/mol. Its IUPAC name is aniline;1-benzyl-3-chlorobenzene;1-bromo-3-chlorobenzene.
Molecular Properties
| Compound Name | aniline;1-benzyl-3-chlorobenzene;1-bromo-3-chlorobenzene |
| PubChem CID | 160894859 |
| Molecular Formula | C25H22BrCl2N |
| Molecular Weight | 487.27 g/mol |
| Exact Mass | 485.03 |
| IUPAC Name | aniline;1-benzyl-3-chlorobenzene;1-bromo-3-chlorobenzene |
| SMILES | Clc1cccc(Br)c1.Clc1cccc(Cc2ccccc2)c1.Nc1ccccc1 |
| InChI | InChI=1S/C13H11Cl.C6H4BrCl.C6H7N/c14-13-8-4-7-12(10-13)9-11-5-2-1-3-6-11;7-5-2-1-3-6(8)4-5;7-6-4-2-1-3-5-6/h1-8,10H,9H2;1-4H;1-5H,7H2 |
| InChIKey | SOSUCSGNMGGWKS-UHFFFAOYSA-N |
| XLogP | 8.30 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 487.27 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze aniline;1-benzyl-3-chlorobenzene;1-bromo-3-chlorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of aniline;1-benzyl-3-chlorobenzene;1-bromo-3-chlorobenzene?
The IUPAC name of aniline;1-benzyl-3-chlorobenzene;1-bromo-3-chlorobenzene (CID 160894859) is aniline;1-benzyl-3-chlorobenzene;1-bromo-3-chlorobenzene.
What is the SMILES notation for aniline;1-benzyl-3-chlorobenzene;1-bromo-3-chlorobenzene?
The canonical SMILES for aniline;1-benzyl-3-chlorobenzene;1-bromo-3-chlorobenzene is Clc1cccc(Br)c1.Clc1cccc(Cc2ccccc2)c1.Nc1ccccc1.
What is the InChIKey of aniline;1-benzyl-3-chlorobenzene;1-bromo-3-chlorobenzene?
The InChIKey is SOSUCSGNMGGWKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11Cl.C6H4BrCl.C6H7N/c14-13-8-4-7-12(10-13)9-11-5-2-1-3-6-11;7-5-2-1-3-6(8)4-5;7-6-4-2-1-3-5-6/h1-8,10H,9H2;1-4H;1-5H,7H2.
What are the key properties of aniline;1-benzyl-3-chlorobenzene;1-bromo-3-chlorobenzene?
aniline;1-benzyl-3-chlorobenzene;1-bromo-3-chlorobenzene has a molecular weight of 487.27 g/mol, XLogP of 8.30, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for aniline;1-benzyl-3-chlorobenzene;1-bromo-3-chlorobenzene is sourced from PubChem (CID 160894859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).