About 4-(difluoromethyl)-2,3-dimethyl-N-(1-methyltetrazol-5-yl)benzamide
4-(difluoromethyl)-2,3-dimethyl-N-(1-methyltetrazol-5-yl)benzamide (PubChem CID 160895407) has the molecular formula C12H13F2N5O
and a molecular weight of 281.27 g/mol. Its IUPAC name is 4-(difluoromethyl)-2,3-dimethyl-N-(1-methyltetrazol-5-yl)benzamide.
Molecular Properties
| Compound Name | 4-(difluoromethyl)-2,3-dimethyl-N-(1-methyltetrazol-5-yl)benzamide |
| PubChem CID | 160895407 |
| Molecular Formula | C12H13F2N5O |
| Molecular Weight | 281.27 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | 4-(difluoromethyl)-2,3-dimethyl-N-(1-methyltetrazol-5-yl)benzamide |
| SMILES | Cc1c(C(=O)Nc2nnnn2C)ccc(C(F)F)c1C |
| InChI | InChI=1S/C12H13F2N5O/c1-6-7(2)9(5-4-8(6)10(13)14)11(20)15-12-16-17-18-19(12)3/h4-5,10H,1-3H3,(H,15,16,18,20) |
| InChIKey | SOUQJOWAXXQGBI-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.27 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(difluoromethyl)-2,3-dimethyl-N-(1-methyltetrazol-5-yl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(difluoromethyl)-2,3-dimethyl-N-(1-methyltetrazol-5-yl)benzamide?
The IUPAC name of 4-(difluoromethyl)-2,3-dimethyl-N-(1-methyltetrazol-5-yl)benzamide (CID 160895407) is 4-(difluoromethyl)-2,3-dimethyl-N-(1-methyltetrazol-5-yl)benzamide.
What is the SMILES notation for 4-(difluoromethyl)-2,3-dimethyl-N-(1-methyltetrazol-5-yl)benzamide?
The canonical SMILES for 4-(difluoromethyl)-2,3-dimethyl-N-(1-methyltetrazol-5-yl)benzamide is Cc1c(C(=O)Nc2nnnn2C)ccc(C(F)F)c1C.
What is the InChIKey of 4-(difluoromethyl)-2,3-dimethyl-N-(1-methyltetrazol-5-yl)benzamide?
The InChIKey is SOUQJOWAXXQGBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13F2N5O/c1-6-7(2)9(5-4-8(6)10(13)14)11(20)15-12-16-17-18-19(12)3/h4-5,10H,1-3H3,(H,15,16,18,20).
What are the key properties of 4-(difluoromethyl)-2,3-dimethyl-N-(1-methyltetrazol-5-yl)benzamide?
4-(difluoromethyl)-2,3-dimethyl-N-(1-methyltetrazol-5-yl)benzamide has a molecular weight of 281.27 g/mol, XLogP of 2.02, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(difluoromethyl)-2,3-dimethyl-N-(1-methyltetrazol-5-yl)benzamide is sourced from PubChem (CID 160895407), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).