About 6-tert-butyl-2-methylimidazo[1,2-b]pyridazine;methane
6-tert-butyl-2-methylimidazo[1,2-b]pyridazine;methane (PubChem CID 160895575) has the molecular formula C12H19N3
and a molecular weight of 205.30 g/mol. Its IUPAC name is 6-tert-butyl-2-methylimidazo[1,2-b]pyridazine;methane.
Molecular Properties
| Compound Name | 6-tert-butyl-2-methylimidazo[1,2-b]pyridazine;methane |
| PubChem CID | 160895575 |
| Molecular Formula | C12H19N3 |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.16 |
| IUPAC Name | 6-tert-butyl-2-methylimidazo[1,2-b]pyridazine;methane |
| SMILES | C.Cc1cn2nc(C(C)(C)C)ccc2n1 |
| InChI | InChI=1S/C11H15N3.CH4/c1-8-7-14-10(12-8)6-5-9(13-14)11(2,3)4;/h5-7H,1-4H3;1H4 |
| InChIKey | SOVFAIRQNJBCDL-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-tert-butyl-2-methylimidazo[1,2-b]pyridazine;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-tert-butyl-2-methylimidazo[1,2-b]pyridazine;methane?
The IUPAC name of 6-tert-butyl-2-methylimidazo[1,2-b]pyridazine;methane (CID 160895575) is 6-tert-butyl-2-methylimidazo[1,2-b]pyridazine;methane.
What is the SMILES notation for 6-tert-butyl-2-methylimidazo[1,2-b]pyridazine;methane?
The canonical SMILES for 6-tert-butyl-2-methylimidazo[1,2-b]pyridazine;methane is C.Cc1cn2nc(C(C)(C)C)ccc2n1.
What is the InChIKey of 6-tert-butyl-2-methylimidazo[1,2-b]pyridazine;methane?
The InChIKey is SOVFAIRQNJBCDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N3.CH4/c1-8-7-14-10(12-8)6-5-9(13-14)11(2,3)4;/h5-7H,1-4H3;1H4.
What are the key properties of 6-tert-butyl-2-methylimidazo[1,2-b]pyridazine;methane?
6-tert-butyl-2-methylimidazo[1,2-b]pyridazine;methane has a molecular weight of 205.30 g/mol, XLogP of 2.97, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-tert-butyl-2-methylimidazo[1,2-b]pyridazine;methane is sourced from PubChem (CID 160895575), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).