C25H24O8 — CID 160895931
7-[[(4R,7aS)-7-methoxy-6,6-dimethyl-2-oxo-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-4-yl]oxy]-4-methyl-3-phenylchromen-2-one (PubChem CID 160895931) has the molecular formula C25H24O8 and a molecular weight of 452.46 g/mol. Its IUPAC name is 7-[[(4R,7aS)-7-methoxy-6,6-dimethyl-2-oxo-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-4-yl]oxy]-4-methyl-3-phenylchromen-2-one.
| Compound Name | 7-[[(4R,7aS)-7-methoxy-6,6-dimethyl-2-oxo-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-4-yl]oxy]-4-methyl-3-phenylchromen-2-one |
|---|---|
| PubChem CID | 160895931 |
| Molecular Formula | C25H24O8 |
| Molecular Weight | 452.46 g/mol |
| Exact Mass | 452.15 |
| IUPAC Name | 7-[[(4R,7aS)-7-methoxy-6,6-dimethyl-2-oxo-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-4-yl]oxy]-4-methyl-3-phenylchromen-2-one |
| SMILES | COC1[C@@H]2OC(=O)OC2[C@H](Oc2ccc3c(C)c(-c4ccccc4)c(=O)oc3c2)OC1(C)C |
| InChI | InChI=1S/C25H24O8/c1-13-16-11-10-15(12-17(16)30-22(26)18(13)14-8-6-5-7-9-14)29-23-20-19(31-24(27)32-20)21(28-4)25(2,3)33-23/h5-12,19-21,23H,1-4H3/t19-,20?,21?,23-/m1/s1 |
| InChIKey | SOWIMKYXOSLABR-ZDTVFLJBSA-N |
| XLogP | 4.20 |
| TPSA | 93.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.46 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|