C44H60O8 — CID 160896399
4,6-ditert-butyl-2-(3,5-ditert-butyl-2,6-dihydroxyphenyl)benzene-1,3-diol;2-(2,6-dihydroxyphenyl)benzene-1,3-diol;2-methylprop-1-ene (PubChem CID 160896399) has the molecular formula C44H60O8 and a molecular weight of 716.96 g/mol. Its IUPAC name is 4,6-ditert-butyl-2-(3,5-ditert-butyl-2,6-dihydroxyphenyl)benzene-1,3-diol;2-(2,6-dihydroxyphenyl)benzene-1,3-diol;2-methylprop-1-ene.
| Compound Name | 4,6-ditert-butyl-2-(3,5-ditert-butyl-2,6-dihydroxyphenyl)benzene-1,3-diol;2-(2,6-dihydroxyphenyl)benzene-1,3-diol;2-methylprop-1-ene |
|---|---|
| PubChem CID | 160896399 |
| Molecular Formula | C44H60O8 |
| Molecular Weight | 716.96 g/mol |
| Exact Mass | 716.43 |
| IUPAC Name | 4,6-ditert-butyl-2-(3,5-ditert-butyl-2,6-dihydroxyphenyl)benzene-1,3-diol;2-(2,6-dihydroxyphenyl)benzene-1,3-diol;2-methylprop-1-ene |
| SMILES | C=C(C)C.CC(C)(C)c1cc(C(C)(C)C)c(O)c(-c2c(O)c(C(C)(C)C)cc(C(C)(C)C)c2O)c1O.Oc1cccc(O)c1-c1c(O)cccc1O |
| InChI | InChI=1S/C28H42O4.C12H10O4.C4H8/c1-25(2,3)15-13-16(26(4,5)6)22(30)19(21(15)29)20-23(31)17(27(7,8)9)14-18(24(20)32)28(10,11)12;13-7-3-1-4-8(14)11(7)12-9(15)5-2-6-10(12)16;1-4(2)3/h13-14,29-32H,1-12H3;1-6,13-16H;1H2,2-3H3 |
| InChIKey | SOXVBPRRGMHRAM-UHFFFAOYSA-N |
| XLogP | 11.12 |
| TPSA | 161.84 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.96 |
| LogP ≤ 5 | 11.12 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|