About 5-chloro-2-[(3,5-dichlorophenyl)sulfonylmethyl]pyridin-3-ol
5-chloro-2-[(3,5-dichlorophenyl)sulfonylmethyl]pyridin-3-ol (PubChem CID 160896978) has the molecular formula C12H8Cl3NO3S
and a molecular weight of 352.63 g/mol. Its IUPAC name is 5-chloro-2-[(3,5-dichlorophenyl)sulfonylmethyl]pyridin-3-ol.
Molecular Properties
| Compound Name | 5-chloro-2-[(3,5-dichlorophenyl)sulfonylmethyl]pyridin-3-ol |
| PubChem CID | 160896978 |
| Molecular Formula | C12H8Cl3NO3S |
| Molecular Weight | 352.63 g/mol |
| Exact Mass | 350.93 |
| IUPAC Name | 5-chloro-2-[(3,5-dichlorophenyl)sulfonylmethyl]pyridin-3-ol |
| SMILES | O=S(=O)(Cc1ncc(Cl)cc1O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C12H8Cl3NO3S/c13-7-1-8(14)3-10(2-7)20(18,19)6-11-12(17)4-9(15)5-16-11/h1-5,17H,6H2 |
| InChIKey | SOZUSXISPIKTQH-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 67.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.63 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-chloro-2-[(3,5-dichlorophenyl)sulfonylmethyl]pyridin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-2-[(3,5-dichlorophenyl)sulfonylmethyl]pyridin-3-ol?
The IUPAC name of 5-chloro-2-[(3,5-dichlorophenyl)sulfonylmethyl]pyridin-3-ol (CID 160896978) is 5-chloro-2-[(3,5-dichlorophenyl)sulfonylmethyl]pyridin-3-ol.
What is the SMILES notation for 5-chloro-2-[(3,5-dichlorophenyl)sulfonylmethyl]pyridin-3-ol?
The canonical SMILES for 5-chloro-2-[(3,5-dichlorophenyl)sulfonylmethyl]pyridin-3-ol is O=S(=O)(Cc1ncc(Cl)cc1O)c1cc(Cl)cc(Cl)c1.
What is the InChIKey of 5-chloro-2-[(3,5-dichlorophenyl)sulfonylmethyl]pyridin-3-ol?
The InChIKey is SOZUSXISPIKTQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8Cl3NO3S/c13-7-1-8(14)3-10(2-7)20(18,19)6-11-12(17)4-9(15)5-16-11/h1-5,17H,6H2.
What are the key properties of 5-chloro-2-[(3,5-dichlorophenyl)sulfonylmethyl]pyridin-3-ol?
5-chloro-2-[(3,5-dichlorophenyl)sulfonylmethyl]pyridin-3-ol has a molecular weight of 352.63 g/mol, XLogP of 3.72, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-2-[(3,5-dichlorophenyl)sulfonylmethyl]pyridin-3-ol is sourced from PubChem (CID 160896978), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).