C29H40N2O5 — CID 160897453
2-[(4S)-2-[2-(3,3-dimethylbutoxy)ethyl]-3-oxo-8-(4-pyridin-2-ylbutoxy)-4,5-dihydro-1H-2-benzazepin-4-yl]acetic acid (PubChem CID 160897453) has the molecular formula C29H40N2O5 and a molecular weight of 496.65 g/mol. Its IUPAC name is 2-[(4S)-2-[2-(3,3-dimethylbutoxy)ethyl]-3-oxo-8-(4-pyridin-2-ylbutoxy)-4,5-dihydro-1H-2-benzazepin-4-yl]acetic acid.
| Compound Name | 2-[(4S)-2-[2-(3,3-dimethylbutoxy)ethyl]-3-oxo-8-(4-pyridin-2-ylbutoxy)-4,5-dihydro-1H-2-benzazepin-4-yl]acetic acid |
|---|---|
| PubChem CID | 160897453 |
| Molecular Formula | C29H40N2O5 |
| Molecular Weight | 496.65 g/mol |
| Exact Mass | 496.29 |
| IUPAC Name | 2-[(4S)-2-[2-(3,3-dimethylbutoxy)ethyl]-3-oxo-8-(4-pyridin-2-ylbutoxy)-4,5-dihydro-1H-2-benzazepin-4-yl]acetic acid |
| SMILES | CC(C)(C)CCOCCN1Cc2cc(OCCCCc3ccccn3)ccc2C[C@@H](CC(=O)O)C1=O |
| InChI | InChI=1S/C29H40N2O5/c1-29(2,3)12-16-35-17-14-31-21-24-19-26(36-15-7-5-9-25-8-4-6-13-30-25)11-10-22(24)18-23(28(31)34)20-27(32)33/h4,6,8,10-11,13,19,23H,5,7,9,12,14-18,20-21H2,1-3H3,(H,32,33)/t23-/m0/s1 |
| InChIKey | YHDBEUYPFLYETA-QHCPKHFHSA-N |
| XLogP | 4.91 |
| TPSA | 88.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.65 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|