C70H52N8 — CID 160897853
2-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-9-ethylcarbazole;3-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-9-ethylcarbazole (PubChem CID 160897853) has the molecular formula C70H52N8 and a molecular weight of 1005.24 g/mol. Its IUPAC name is 2-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-9-ethylcarbazole;3-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-9-ethylcarbazole.
| Compound Name | 2-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-9-ethylcarbazole;3-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-9-ethylcarbazole |
|---|---|
| PubChem CID | 160897853 |
| Molecular Formula | C70H52N8 |
| Molecular Weight | 1005.24 g/mol |
| Exact Mass | 1004.43 |
| IUPAC Name | 2-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-9-ethylcarbazole;3-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-9-ethylcarbazole |
| SMILES | CCn1c2ccccc2c2cc(-c3cccc(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)c3)ccc21.CCn1c2ccccc2c2ccc(-c3cccc(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)c3)cc21 |
| InChI | InChI=1S/2C35H26N4/c1-2-39-31-19-10-9-18-29(31)30-23-27(20-21-32(30)39)26-16-11-17-28(22-26)35-37-33(24-12-5-3-6-13-24)36-34(38-35)25-14-7-4-8-15-25;1-2-39-31-19-10-9-18-29(31)30-21-20-27(23-32(30)39)26-16-11-17-28(22-26)35-37-33(24-12-5-3-6-13-24)36-34(38-35)25-14-7-4-8-15-25/h2*3-23H,2H2,1H3 |
| InChIKey | SPCLKPQTMWMLJZ-UHFFFAOYSA-N |
| XLogP | 17.33 |
| TPSA | 87.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 78 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1005.24 |
| LogP ≤ 5 | 17.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |