About N'-aminoimidazo[1,2-a]pyridine-6-carboximidamide;propanoic acid
N'-aminoimidazo[1,2-a]pyridine-6-carboximidamide;propanoic acid (PubChem CID 160898215) has the molecular formula C11H15N5O2
and a molecular weight of 249.27 g/mol. Its IUPAC name is N'-aminoimidazo[1,2-a]pyridine-6-carboximidamide;propanoic acid.
Molecular Properties
| Compound Name | N'-aminoimidazo[1,2-a]pyridine-6-carboximidamide;propanoic acid |
| PubChem CID | 160898215 |
| Molecular Formula | C11H15N5O2 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.12 |
| IUPAC Name | N'-aminoimidazo[1,2-a]pyridine-6-carboximidamide;propanoic acid |
| SMILES | CCC(=O)O.NN=C(N)c1ccc2nccn2c1 |
| InChI | InChI=1S/C8H9N5.C3H6O2/c9-8(12-10)6-1-2-7-11-3-4-13(7)5-6;1-2-3(4)5/h1-5H,10H2,(H2,9,12);2H2,1H3,(H,4,5) |
| InChIKey | SPDRPHGKGSXDRI-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-aminoimidazo[1,2-a]pyridine-6-carboximidamide;propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-aminoimidazo[1,2-a]pyridine-6-carboximidamide;propanoic acid?
The IUPAC name of N'-aminoimidazo[1,2-a]pyridine-6-carboximidamide;propanoic acid (CID 160898215) is N'-aminoimidazo[1,2-a]pyridine-6-carboximidamide;propanoic acid.
What is the SMILES notation for N'-aminoimidazo[1,2-a]pyridine-6-carboximidamide;propanoic acid?
The canonical SMILES for N'-aminoimidazo[1,2-a]pyridine-6-carboximidamide;propanoic acid is CCC(=O)O.NN=C(N)c1ccc2nccn2c1.
What is the InChIKey of N'-aminoimidazo[1,2-a]pyridine-6-carboximidamide;propanoic acid?
The InChIKey is SPDRPHGKGSXDRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N5.C3H6O2/c9-8(12-10)6-1-2-7-11-3-4-13(7)5-6;1-2-3(4)5/h1-5H,10H2,(H2,9,12);2H2,1H3,(H,4,5).
What are the key properties of N'-aminoimidazo[1,2-a]pyridine-6-carboximidamide;propanoic acid?
N'-aminoimidazo[1,2-a]pyridine-6-carboximidamide;propanoic acid has a molecular weight of 249.27 g/mol, XLogP of 0.39, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N'-aminoimidazo[1,2-a]pyridine-6-carboximidamide;propanoic acid is sourced from PubChem (CID 160898215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).