C24H27NO8 — CID 160898664
1-(5-methoxy-2-nitro-4-prop-2-enoxyphenyl)ethanone;1-(3-methoxy-4-prop-2-enoxyphenyl)ethanone (PubChem CID 160898664) has the molecular formula C24H27NO8 and a molecular weight of 457.48 g/mol. Its IUPAC name is 1-(5-methoxy-2-nitro-4-prop-2-enoxyphenyl)ethanone;1-(3-methoxy-4-prop-2-enoxyphenyl)ethanone.
| Compound Name | 1-(5-methoxy-2-nitro-4-prop-2-enoxyphenyl)ethanone;1-(3-methoxy-4-prop-2-enoxyphenyl)ethanone |
|---|---|
| PubChem CID | 160898664 |
| Molecular Formula | C24H27NO8 |
| Molecular Weight | 457.48 g/mol |
| Exact Mass | 457.17 |
| IUPAC Name | 1-(5-methoxy-2-nitro-4-prop-2-enoxyphenyl)ethanone;1-(3-methoxy-4-prop-2-enoxyphenyl)ethanone |
| SMILES | C=CCOc1cc([N+](=O)[O-])c(C(C)=O)cc1OC.C=CCOc1ccc(C(C)=O)cc1OC |
| InChI | InChI=1S/C12H13NO5.C12H14O3/c1-4-5-18-12-7-10(13(15)16)9(8(2)14)6-11(12)17-3;1-4-7-15-11-6-5-10(9(2)13)8-12(11)14-3/h4,6-7H,1,5H2,2-3H3;4-6,8H,1,7H2,2-3H3 |
| InChIKey | SPFFFARNDHPWPW-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 114.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.48 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|