About 2-[4-[1-[6-(4-acetyl-3-methoxyphenyl)-2-pyridinyl]ethoxy]-2-methylphenoxy]acetic acid;butane
2-[4-[1-[6-(4-acetyl-3-methoxyphenyl)-2-pyridinyl]ethoxy]-2-methylphenoxy]acetic acid;butane (PubChem CID 160899507) has the molecular formula C29H35NO6
and a molecular weight of 493.60 g/mol. Its IUPAC name is 2-[4-[1-[6-(4-acetyl-3-methoxyphenyl)-2-pyridinyl]ethoxy]-2-methylphenoxy]acetic acid;butane.
Molecular Properties
| Compound Name | 2-[4-[1-[6-(4-acetyl-3-methoxyphenyl)-2-pyridinyl]ethoxy]-2-methylphenoxy]acetic acid;butane |
| PubChem CID | 160899507 |
| Molecular Formula | C29H35NO6 |
| Molecular Weight | 493.60 g/mol |
| Exact Mass | 493.25 |
| IUPAC Name | 2-[4-[1-[6-(4-acetyl-3-methoxyphenyl)-2-pyridinyl]ethoxy]-2-methylphenoxy]acetic acid;butane |
| SMILES | CCCC.COc1cc(-c2cccc(C(C)Oc3ccc(OCC(=O)O)c(C)c3)n2)ccc1C(C)=O |
| InChI | InChI=1S/C25H25NO6.C4H10/c1-15-12-19(9-11-23(15)31-14-25(28)29)32-17(3)21-6-5-7-22(26-21)18-8-10-20(16(2)27)24(13-18)30-4;1-3-4-2/h5-13,17H,14H2,1-4H3,(H,28,29);3-4H2,1-2H3 |
| InChIKey | SPHUTQYMSJWHFI-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 94.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 493.60 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[4-[1-[6-(4-acetyl-3-methoxyphenyl)-2-pyridinyl]ethoxy]-2-methylphenoxy]acetic acid;butane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[1-[6-(4-acetyl-3-methoxyphenyl)-2-pyridinyl]ethoxy]-2-methylphenoxy]acetic acid;butane?
The IUPAC name of 2-[4-[1-[6-(4-acetyl-3-methoxyphenyl)-2-pyridinyl]ethoxy]-2-methylphenoxy]acetic acid;butane (CID 160899507) is 2-[4-[1-[6-(4-acetyl-3-methoxyphenyl)-2-pyridinyl]ethoxy]-2-methylphenoxy]acetic acid;butane.
What is the SMILES notation for 2-[4-[1-[6-(4-acetyl-3-methoxyphenyl)-2-pyridinyl]ethoxy]-2-methylphenoxy]acetic acid;butane?
The canonical SMILES for 2-[4-[1-[6-(4-acetyl-3-methoxyphenyl)-2-pyridinyl]ethoxy]-2-methylphenoxy]acetic acid;butane is CCCC.COc1cc(-c2cccc(C(C)Oc3ccc(OCC(=O)O)c(C)c3)n2)ccc1C(C)=O.
What is the InChIKey of 2-[4-[1-[6-(4-acetyl-3-methoxyphenyl)-2-pyridinyl]ethoxy]-2-methylphenoxy]acetic acid;butane?
The InChIKey is SPHUTQYMSJWHFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H25NO6.C4H10/c1-15-12-19(9-11-23(15)31-14-25(28)29)32-17(3)21-6-5-7-22(26-21)18-8-10-20(16(2)27)24(13-18)30-4;1-3-4-2/h5-13,17H,14H2,1-4H3,(H,28,29);3-4H2,1-2H3.
What are the key properties of 2-[4-[1-[6-(4-acetyl-3-methoxyphenyl)-2-pyridinyl]ethoxy]-2-methylphenoxy]acetic acid;butane?
2-[4-[1-[6-(4-acetyl-3-methoxyphenyl)-2-pyridinyl]ethoxy]-2-methylphenoxy]acetic acid;butane has a molecular weight of 493.60 g/mol, XLogP of 6.68, 10 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[1-[6-(4-acetyl-3-methoxyphenyl)-2-pyridinyl]ethoxy]-2-methylphenoxy]acetic acid;butane is sourced from PubChem (CID 160899507), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).