About ethyl 2-(4-hydroxypyrazol-1-yl)-3-methylbutanoate;2-(4-hydroxypyrazol-1-yl)-3-methylbutanoic acid
ethyl 2-(4-hydroxypyrazol-1-yl)-3-methylbutanoate;2-(4-hydroxypyrazol-1-yl)-3-methylbutanoic acid (PubChem CID 160900881) has the molecular formula C18H28N4O6
and a molecular weight of 396.44 g/mol. Its IUPAC name is ethyl 2-(4-hydroxypyrazol-1-yl)-3-methylbutanoate;2-(4-hydroxypyrazol-1-yl)-3-methylbutanoic acid.
Molecular Properties
| Compound Name | ethyl 2-(4-hydroxypyrazol-1-yl)-3-methylbutanoate;2-(4-hydroxypyrazol-1-yl)-3-methylbutanoic acid |
| PubChem CID | 160900881 |
| Molecular Formula | C18H28N4O6 |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | ethyl 2-(4-hydroxypyrazol-1-yl)-3-methylbutanoate;2-(4-hydroxypyrazol-1-yl)-3-methylbutanoic acid |
| SMILES | CC(C)C(C(=O)O)n1cc(O)cn1.CCOC(=O)C(C(C)C)n1cc(O)cn1 |
| InChI | InChI=1S/C10H16N2O3.C8H12N2O3/c1-4-15-10(14)9(7(2)3)12-6-8(13)5-11-12;1-5(2)7(8(12)13)10-4-6(11)3-9-10/h5-7,9,13H,4H2,1-3H3;3-5,7,11H,1-2H3,(H,12,13) |
| InChIKey | SPMFXLPTVHGQRP-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 139.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze ethyl 2-(4-hydroxypyrazol-1-yl)-3-methylbutanoate;2-(4-hydroxypyrazol-1-yl)-3-methylbutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(4-hydroxypyrazol-1-yl)-3-methylbutanoate;2-(4-hydroxypyrazol-1-yl)-3-methylbutanoic acid?
The IUPAC name of ethyl 2-(4-hydroxypyrazol-1-yl)-3-methylbutanoate;2-(4-hydroxypyrazol-1-yl)-3-methylbutanoic acid (CID 160900881) is ethyl 2-(4-hydroxypyrazol-1-yl)-3-methylbutanoate;2-(4-hydroxypyrazol-1-yl)-3-methylbutanoic acid.
What is the SMILES notation for ethyl 2-(4-hydroxypyrazol-1-yl)-3-methylbutanoate;2-(4-hydroxypyrazol-1-yl)-3-methylbutanoic acid?
The canonical SMILES for ethyl 2-(4-hydroxypyrazol-1-yl)-3-methylbutanoate;2-(4-hydroxypyrazol-1-yl)-3-methylbutanoic acid is CC(C)C(C(=O)O)n1cc(O)cn1.CCOC(=O)C(C(C)C)n1cc(O)cn1.
What is the InChIKey of ethyl 2-(4-hydroxypyrazol-1-yl)-3-methylbutanoate;2-(4-hydroxypyrazol-1-yl)-3-methylbutanoic acid?
The InChIKey is SPMFXLPTVHGQRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2O3.C8H12N2O3/c1-4-15-10(14)9(7(2)3)12-6-8(13)5-11-12;1-5(2)7(8(12)13)10-4-6(11)3-9-10/h5-7,9,13H,4H2,1-3H3;3-5,7,11H,1-2H3,(H,12,13).
What are the key properties of ethyl 2-(4-hydroxypyrazol-1-yl)-3-methylbutanoate;2-(4-hydroxypyrazol-1-yl)-3-methylbutanoic acid?
ethyl 2-(4-hydroxypyrazol-1-yl)-3-methylbutanoate;2-(4-hydroxypyrazol-1-yl)-3-methylbutanoic acid has a molecular weight of 396.44 g/mol, XLogP of 2.22, 7 rotatable bonds, 3 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(4-hydroxypyrazol-1-yl)-3-methylbutanoate;2-(4-hydroxypyrazol-1-yl)-3-methylbutanoic acid is sourced from PubChem (CID 160900881), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).