About 6-methyl-1H-pyrimidine-2,4-dione
6-methyl-1H-pyrimidine-2,4-dione (PubChem CID 160901514) has the molecular formula C10H12N4O4
and a molecular weight of 252.23 g/mol. Its IUPAC name is 6-methyl-1H-pyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 6-methyl-1H-pyrimidine-2,4-dione |
| PubChem CID | 160901514 |
| Molecular Formula | C10H12N4O4 |
| Molecular Weight | 252.23 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | 6-methyl-1H-pyrimidine-2,4-dione |
| SMILES | Cc1cc(=O)[nH]c(=O)[nH]1.Cc1cc(=O)[nH]c(=O)[nH]1 |
| InChI | InChI=1S/2C5H6N2O2/c2*1-3-2-4(8)7-5(9)6-3/h2*2H,1H3,(H2,6,7,8,9) |
| InChIKey | SPOJJYVGKCRURU-UHFFFAOYSA-N |
| XLogP | -1.26 |
| TPSA | 131.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.23 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-methyl-1H-pyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-1H-pyrimidine-2,4-dione?
The IUPAC name of 6-methyl-1H-pyrimidine-2,4-dione (CID 160901514) is 6-methyl-1H-pyrimidine-2,4-dione.
What is the SMILES notation for 6-methyl-1H-pyrimidine-2,4-dione?
The canonical SMILES for 6-methyl-1H-pyrimidine-2,4-dione is Cc1cc(=O)[nH]c(=O)[nH]1.Cc1cc(=O)[nH]c(=O)[nH]1.
What is the InChIKey of 6-methyl-1H-pyrimidine-2,4-dione?
The InChIKey is SPOJJYVGKCRURU-UHFFFAOYSA-N. The full InChI is InChI=1S/2C5H6N2O2/c2*1-3-2-4(8)7-5(9)6-3/h2*2H,1H3,(H2,6,7,8,9).
What are the key properties of 6-methyl-1H-pyrimidine-2,4-dione?
6-methyl-1H-pyrimidine-2,4-dione has a molecular weight of 252.23 g/mol, XLogP of -1.26, 0 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-1H-pyrimidine-2,4-dione is sourced from PubChem (CID 160901514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).