C23H24N2O — CID 160904336
2-[4-[2-(cyclopropylmethylamino)cyclopropyl]phenyl]-1-(1H-indol-3-yl)ethanone (PubChem CID 160904336) has the molecular formula C23H24N2O and a molecular weight of 344.46 g/mol. Its IUPAC name is 2-[4-[2-(cyclopropylmethylamino)cyclopropyl]phenyl]-1-(1H-indol-3-yl)ethanone.
| Compound Name | 2-[4-[2-(cyclopropylmethylamino)cyclopropyl]phenyl]-1-(1H-indol-3-yl)ethanone |
|---|---|
| PubChem CID | 160904336 |
| Molecular Formula | C23H24N2O |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.19 |
| IUPAC Name | 2-[4-[2-(cyclopropylmethylamino)cyclopropyl]phenyl]-1-(1H-indol-3-yl)ethanone |
| SMILES | O=C(Cc1ccc(C2CC2NCC2CC2)cc1)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C23H24N2O/c26-23(20-14-25-21-4-2-1-3-18(20)21)11-15-7-9-17(10-8-15)19-12-22(19)24-13-16-5-6-16/h1-4,7-10,14,16,19,22,24-25H,5-6,11-13H2 |
| InChIKey | SPXSNGGCSDDLAG-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |