C44H50N2NaO5S+ — CID 160904636
sodium 3-[2-[2-[3-[2-(1-butyl-3,3-dimethylindol-2-ylidene)ethylidene]-2-(4-carboxyphenyl)cyclohexen-1-yl]ethenyl]-3,3-dimethylindol-1-ium-1-yl]propane-1-sulfonate (PubChem CID 160904636) has the molecular formula C44H50N2NaO5S+ and a molecular weight of 741.95 g/mol. Its IUPAC name is sodium 3-[2-[2-[3-[2-(1-butyl-3,3-dimethylindol-2-ylidene)ethylidene]-2-(4-carboxyphenyl)cyclohexen-1-yl]ethenyl]-3,3-dimethylindol-1-ium-1-yl]propane-1-sulfonate.
| Compound Name | sodium 3-[2-[2-[3-[2-(1-butyl-3,3-dimethylindol-2-ylidene)ethylidene]-2-(4-carboxyphenyl)cyclohexen-1-yl]ethenyl]-3,3-dimethylindol-1-ium-1-yl]propane-1-sulfonate |
|---|---|
| PubChem CID | 160904636 |
| Molecular Formula | C44H50N2NaO5S+ |
| Molecular Weight | 741.95 g/mol |
| Exact Mass | 741.33 |
| IUPAC Name | sodium 3-[2-[2-[3-[2-(1-butyl-3,3-dimethylindol-2-ylidene)ethylidene]-2-(4-carboxyphenyl)cyclohexen-1-yl]ethenyl]-3,3-dimethylindol-1-ium-1-yl]propane-1-sulfonate |
| SMILES | CCCCN1C(=CC=C2CCCC(C=CC3=[N+](CCCS(=O)(=O)[O-])c4ccccc4C3(C)C)=C2c2ccc(C(=O)O)cc2)C(C)(C)c2ccccc21.[Na+] |
| InChI | InChI=1S/C44H50N2O5S.Na/c1-6-7-28-45-37-18-10-8-16-35(37)43(2,3)39(45)26-24-31-14-12-15-32(41(31)33-20-22-34(23-21-33)42(47)48)25-27-40-44(4,5)36-17-9-11-19-38(36)46(40)29-13-30-52(49,50)51;/h8-11,16-27H,6-7,12-15,28-30H2,1-5H3,(H-,47,48,49,50,51);/q;+1 |
| InChIKey | SPYWWLOJCYFKNP-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 100.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.95 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|