About (2S)-2-[[(3S)-pyrrolidin-3-yl]methylamino]propan-1-ol;sulfane
(2S)-2-[[(3S)-pyrrolidin-3-yl]methylamino]propan-1-ol;sulfane (PubChem CID 160904644) has the molecular formula C8H22N2OS2
and a molecular weight of 226.41 g/mol. Its IUPAC name is (2S)-2-[[(3S)-pyrrolidin-3-yl]methylamino]propan-1-ol;sulfane.
Molecular Properties
| Compound Name | (2S)-2-[[(3S)-pyrrolidin-3-yl]methylamino]propan-1-ol;sulfane |
| PubChem CID | 160904644 |
| Molecular Formula | C8H22N2OS2 |
| Molecular Weight | 226.41 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | (2S)-2-[[(3S)-pyrrolidin-3-yl]methylamino]propan-1-ol;sulfane |
| SMILES | C[C@@H](CO)NC[C@H]1CCNC1.S.S |
| InChI | InChI=1S/C8H18N2O.2H2S/c1-7(6-11)10-5-8-2-3-9-4-8;;/h7-11H,2-6H2,1H3;2*1H2/t7-,8-;;/m0../s1 |
| InChIKey | SPYYQGMWQAGMSN-FOMWZSOGSA-N |
| XLogP | -0.21 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.41 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2S)-2-[[(3S)-pyrrolidin-3-yl]methylamino]propan-1-ol;sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-[[(3S)-pyrrolidin-3-yl]methylamino]propan-1-ol;sulfane?
The IUPAC name of (2S)-2-[[(3S)-pyrrolidin-3-yl]methylamino]propan-1-ol;sulfane (CID 160904644) is (2S)-2-[[(3S)-pyrrolidin-3-yl]methylamino]propan-1-ol;sulfane.
What is the SMILES notation for (2S)-2-[[(3S)-pyrrolidin-3-yl]methylamino]propan-1-ol;sulfane?
The canonical SMILES for (2S)-2-[[(3S)-pyrrolidin-3-yl]methylamino]propan-1-ol;sulfane is C[C@@H](CO)NC[C@H]1CCNC1.S.S.
What is the InChIKey of (2S)-2-[[(3S)-pyrrolidin-3-yl]methylamino]propan-1-ol;sulfane?
The InChIKey is SPYYQGMWQAGMSN-FOMWZSOGSA-N. The full InChI is InChI=1S/C8H18N2O.2H2S/c1-7(6-11)10-5-8-2-3-9-4-8;;/h7-11H,2-6H2,1H3;2*1H2/t7-,8-;;/m0../s1.
What are the key properties of (2S)-2-[[(3S)-pyrrolidin-3-yl]methylamino]propan-1-ol;sulfane?
(2S)-2-[[(3S)-pyrrolidin-3-yl]methylamino]propan-1-ol;sulfane has a molecular weight of 226.41 g/mol, XLogP of -0.21, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-[[(3S)-pyrrolidin-3-yl]methylamino]propan-1-ol;sulfane is sourced from PubChem (CID 160904644), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).