About tert-butyl N-[(3R)-4,4-difluoro-1-(5-fluoro-3H-indol-2-yl)piperidin-3-yl]carbamate
tert-butyl N-[(3R)-4,4-difluoro-1-(5-fluoro-3H-indol-2-yl)piperidin-3-yl]carbamate (PubChem CID 160905501) has the molecular formula C18H22F3N3O2
and a molecular weight of 369.39 g/mol. Its IUPAC name is tert-butyl N-[(3R)-4,4-difluoro-1-(5-fluoro-3H-indol-2-yl)piperidin-3-yl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[(3R)-4,4-difluoro-1-(5-fluoro-3H-indol-2-yl)piperidin-3-yl]carbamate |
| PubChem CID | 160905501 |
| Molecular Formula | C18H22F3N3O2 |
| Molecular Weight | 369.39 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | tert-butyl N-[(3R)-4,4-difluoro-1-(5-fluoro-3H-indol-2-yl)piperidin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CN(C2=Nc3ccc(F)cc3C2)CCC1(F)F |
| InChI | InChI=1S/C18H22F3N3O2/c1-17(2,3)26-16(25)23-14-10-24(7-6-18(14,20)21)15-9-11-8-12(19)4-5-13(11)22-15/h4-5,8,14H,6-7,9-10H2,1-3H3,(H,23,25)/t14-/m1/s1 |
| InChIKey | SQBYDFLBDFRXEN-CQSZACIVSA-N |
| XLogP | 3.65 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.39 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze tert-butyl N-[(3R)-4,4-difluoro-1-(5-fluoro-3H-indol-2-yl)piperidin-3-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[(3R)-4,4-difluoro-1-(5-fluoro-3H-indol-2-yl)piperidin-3-yl]carbamate?
The IUPAC name of tert-butyl N-[(3R)-4,4-difluoro-1-(5-fluoro-3H-indol-2-yl)piperidin-3-yl]carbamate (CID 160905501) is tert-butyl N-[(3R)-4,4-difluoro-1-(5-fluoro-3H-indol-2-yl)piperidin-3-yl]carbamate.
What is the SMILES notation for tert-butyl N-[(3R)-4,4-difluoro-1-(5-fluoro-3H-indol-2-yl)piperidin-3-yl]carbamate?
The canonical SMILES for tert-butyl N-[(3R)-4,4-difluoro-1-(5-fluoro-3H-indol-2-yl)piperidin-3-yl]carbamate is CC(C)(C)OC(=O)N[C@@H]1CN(C2=Nc3ccc(F)cc3C2)CCC1(F)F.
What is the InChIKey of tert-butyl N-[(3R)-4,4-difluoro-1-(5-fluoro-3H-indol-2-yl)piperidin-3-yl]carbamate?
The InChIKey is SQBYDFLBDFRXEN-CQSZACIVSA-N. The full InChI is InChI=1S/C18H22F3N3O2/c1-17(2,3)26-16(25)23-14-10-24(7-6-18(14,20)21)15-9-11-8-12(19)4-5-13(11)22-15/h4-5,8,14H,6-7,9-10H2,1-3H3,(H,23,25)/t14-/m1/s1.
What are the key properties of tert-butyl N-[(3R)-4,4-difluoro-1-(5-fluoro-3H-indol-2-yl)piperidin-3-yl]carbamate?
tert-butyl N-[(3R)-4,4-difluoro-1-(5-fluoro-3H-indol-2-yl)piperidin-3-yl]carbamate has a molecular weight of 369.39 g/mol, XLogP of 3.65, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[(3R)-4,4-difluoro-1-(5-fluoro-3H-indol-2-yl)piperidin-3-yl]carbamate is sourced from PubChem (CID 160905501), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).