About 5-[3-(3,5-difluoro-4-methylphenyl)phenyl]-N-(2-fluorophenyl)-1,3-oxazol-2-amine
5-[3-(3,5-difluoro-4-methylphenyl)phenyl]-N-(2-fluorophenyl)-1,3-oxazol-2-amine (PubChem CID 160905582) has the molecular formula C22H15F3N2O
and a molecular weight of 380.37 g/mol. Its IUPAC name is 5-[3-(3,5-difluoro-4-methylphenyl)phenyl]-N-(2-fluorophenyl)-1,3-oxazol-2-amine.
Molecular Properties
| Compound Name | 5-[3-(3,5-difluoro-4-methylphenyl)phenyl]-N-(2-fluorophenyl)-1,3-oxazol-2-amine |
| PubChem CID | 160905582 |
| Molecular Formula | C22H15F3N2O |
| Molecular Weight | 380.37 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | 5-[3-(3,5-difluoro-4-methylphenyl)phenyl]-N-(2-fluorophenyl)-1,3-oxazol-2-amine |
| SMILES | Cc1c(F)cc(-c2cccc(-c3cnc(Nc4ccccc4F)o3)c2)cc1F |
| InChI | InChI=1S/C22H15F3N2O/c1-13-18(24)10-16(11-19(13)25)14-5-4-6-15(9-14)21-12-26-22(28-21)27-20-8-3-2-7-17(20)23/h2-12H,1H3,(H,26,27) |
| InChIKey | TUQUPRCGIHQGTP-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 380.37 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-[3-(3,5-difluoro-4-methylphenyl)phenyl]-N-(2-fluorophenyl)-1,3-oxazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[3-(3,5-difluoro-4-methylphenyl)phenyl]-N-(2-fluorophenyl)-1,3-oxazol-2-amine?
The IUPAC name of 5-[3-(3,5-difluoro-4-methylphenyl)phenyl]-N-(2-fluorophenyl)-1,3-oxazol-2-amine (CID 160905582) is 5-[3-(3,5-difluoro-4-methylphenyl)phenyl]-N-(2-fluorophenyl)-1,3-oxazol-2-amine.
What is the SMILES notation for 5-[3-(3,5-difluoro-4-methylphenyl)phenyl]-N-(2-fluorophenyl)-1,3-oxazol-2-amine?
The canonical SMILES for 5-[3-(3,5-difluoro-4-methylphenyl)phenyl]-N-(2-fluorophenyl)-1,3-oxazol-2-amine is Cc1c(F)cc(-c2cccc(-c3cnc(Nc4ccccc4F)o3)c2)cc1F.
What is the InChIKey of 5-[3-(3,5-difluoro-4-methylphenyl)phenyl]-N-(2-fluorophenyl)-1,3-oxazol-2-amine?
The InChIKey is TUQUPRCGIHQGTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H15F3N2O/c1-13-18(24)10-16(11-19(13)25)14-5-4-6-15(9-14)21-12-26-22(28-21)27-20-8-3-2-7-17(20)23/h2-12H,1H3,(H,26,27).
What are the key properties of 5-[3-(3,5-difluoro-4-methylphenyl)phenyl]-N-(2-fluorophenyl)-1,3-oxazol-2-amine?
5-[3-(3,5-difluoro-4-methylphenyl)phenyl]-N-(2-fluorophenyl)-1,3-oxazol-2-amine has a molecular weight of 380.37 g/mol, XLogP of 6.48, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[3-(3,5-difluoro-4-methylphenyl)phenyl]-N-(2-fluorophenyl)-1,3-oxazol-2-amine is sourced from PubChem (CID 160905582), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).