C28H36F6O6Si — CID 160906211
ethyl (3S)-3-[tert-butyl(diphenyl)silyl]oxy-4,4,4-trifluorobutanoate;ethyl (3R)-4,4,4-trifluoro-3-hydroxybutanoate (PubChem CID 160906211) has the molecular formula C28H36F6O6Si and a molecular weight of 610.66 g/mol. Its IUPAC name is ethyl (3S)-3-[tert-butyl(diphenyl)silyl]oxy-4,4,4-trifluorobutanoate;ethyl (3R)-4,4,4-trifluoro-3-hydroxybutanoate.
| Compound Name | ethyl (3S)-3-[tert-butyl(diphenyl)silyl]oxy-4,4,4-trifluorobutanoate;ethyl (3R)-4,4,4-trifluoro-3-hydroxybutanoate |
|---|---|
| PubChem CID | 160906211 |
| Molecular Formula | C28H36F6O6Si |
| Molecular Weight | 610.66 g/mol |
| Exact Mass | 610.22 |
| IUPAC Name | ethyl (3S)-3-[tert-butyl(diphenyl)silyl]oxy-4,4,4-trifluorobutanoate;ethyl (3R)-4,4,4-trifluoro-3-hydroxybutanoate |
| SMILES | CCOC(=O)C[C@@H](O)C(F)(F)F.CCOC(=O)C[C@H](O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C(F)(F)F |
| InChI | InChI=1S/C22H27F3O3Si.C6H9F3O3/c1-5-27-20(26)16-19(22(23,24)25)28-29(21(2,3)4,17-12-8-6-9-13-17)18-14-10-7-11-15-18;1-2-12-5(11)3-4(10)6(7,8)9/h6-15,19H,5,16H2,1-4H3;4,10H,2-3H2,1H3/t19-;4-/m01/s1 |
| InChIKey | SQECPSCSLNHITB-NPXBBXOISA-N |
| XLogP | 5.31 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.66 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|