About bis(2-(3-methyl-2,5-dioxopyrrol-1-yl)butanoic acid);zinc
bis(2-(3-methyl-2,5-dioxopyrrol-1-yl)butanoic acid);zinc (PubChem CID 160906836) has the molecular formula C18H22N2O8Zn
and a molecular weight of 459.77 g/mol. Its IUPAC name is bis(2-(3-methyl-2,5-dioxopyrrol-1-yl)butanoic acid);zinc.
Molecular Properties
| Compound Name | bis(2-(3-methyl-2,5-dioxopyrrol-1-yl)butanoic acid);zinc |
| PubChem CID | 160906836 |
| Molecular Formula | C18H22N2O8Zn |
| Molecular Weight | 459.77 g/mol |
| Exact Mass | 458.07 |
| IUPAC Name | bis(2-(3-methyl-2,5-dioxopyrrol-1-yl)butanoic acid);zinc |
| SMILES | CCC(C(=O)O)N1C(=O)C=C(C)C1=O.CCC(C(=O)O)N1C(=O)C=C(C)C1=O.[Zn] |
| InChI | InChI=1S/2C9H11NO4.Zn/c2*1-3-6(9(13)14)10-7(11)4-5(2)8(10)12;/h2*4,6H,3H2,1-2H3,(H,13,14); |
| InChIKey | SQGISAZEBIESBN-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 149.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 459.77 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze bis(2-(3-methyl-2,5-dioxopyrrol-1-yl)butanoic acid);zinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-(3-methyl-2,5-dioxopyrrol-1-yl)butanoic acid);zinc?
The IUPAC name of bis(2-(3-methyl-2,5-dioxopyrrol-1-yl)butanoic acid);zinc (CID 160906836) is bis(2-(3-methyl-2,5-dioxopyrrol-1-yl)butanoic acid);zinc.
What is the SMILES notation for bis(2-(3-methyl-2,5-dioxopyrrol-1-yl)butanoic acid);zinc?
The canonical SMILES for bis(2-(3-methyl-2,5-dioxopyrrol-1-yl)butanoic acid);zinc is CCC(C(=O)O)N1C(=O)C=C(C)C1=O.CCC(C(=O)O)N1C(=O)C=C(C)C1=O.[Zn].
What is the InChIKey of bis(2-(3-methyl-2,5-dioxopyrrol-1-yl)butanoic acid);zinc?
The InChIKey is SQGISAZEBIESBN-UHFFFAOYSA-N. The full InChI is InChI=1S/2C9H11NO4.Zn/c2*1-3-6(9(13)14)10-7(11)4-5(2)8(10)12;/h2*4,6H,3H2,1-2H3,(H,13,14);.
What are the key properties of bis(2-(3-methyl-2,5-dioxopyrrol-1-yl)butanoic acid);zinc?
bis(2-(3-methyl-2,5-dioxopyrrol-1-yl)butanoic acid);zinc has a molecular weight of 459.77 g/mol, XLogP of 0.33, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-(3-methyl-2,5-dioxopyrrol-1-yl)butanoic acid);zinc is sourced from PubChem (CID 160906836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).