C19H24N2O3 — CID 160908240
(2E)-2-isocyano-2-(2,2,6-trimethyl-3H-pyran-4-ylidene)acetonitrile;2,2,6-trimethyl-3H-pyran-4-one (PubChem CID 160908240) has the molecular formula C19H24N2O3 and a molecular weight of 328.41 g/mol. Its IUPAC name is (2E)-2-isocyano-2-(2,2,6-trimethyl-3H-pyran-4-ylidene)acetonitrile;2,2,6-trimethyl-3H-pyran-4-one.
| Compound Name | (2E)-2-isocyano-2-(2,2,6-trimethyl-3H-pyran-4-ylidene)acetonitrile;2,2,6-trimethyl-3H-pyran-4-one |
|---|---|
| PubChem CID | 160908240 |
| Molecular Formula | C19H24N2O3 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | (2E)-2-isocyano-2-(2,2,6-trimethyl-3H-pyran-4-ylidene)acetonitrile;2,2,6-trimethyl-3H-pyran-4-one |
| SMILES | CC1=CC(=O)CC(C)(C)O1.[C-]#[N+]/C(C#N)=C1/C=C(C)OC(C)(C)C1 |
| InChI | InChI=1S/C11H12N2O.C8H12O2/c1-8-5-9(10(7-12)13-4)6-11(2,3)14-8;1-6-4-7(9)5-8(2,3)10-6/h5H,6H2,1-3H3;4H,5H2,1-3H3/b10-9-; |
| InChIKey | SQKSEHPNJVQIRQ-KVVVOXFISA-N |
| XLogP | 4.44 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|