C23H33N5O6S — CID 160908370
(4R,5R,6R)-6-[(2S)-6-amino-4,6-dioxohexan-2-yl]-3-[(3S,5S)-5-[(3S)-3-aminopyrrolidine-1-carbonyl]pyrrolidin-3-yl]sulfanyl-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid (PubChem CID 160908370) has the molecular formula C23H33N5O6S and a molecular weight of 507.61 g/mol. Its IUPAC name is (4R,5R,6R)-6-[(2S)-6-amino-4,6-dioxohexan-2-yl]-3-[(3S,5S)-5-[(3S)-3-aminopyrrolidine-1-carbonyl]pyrrolidin-3-yl]sulfanyl-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid.
| Compound Name | (4R,5R,6R)-6-[(2S)-6-amino-4,6-dioxohexan-2-yl]-3-[(3S,5S)-5-[(3S)-3-aminopyrrolidine-1-carbonyl]pyrrolidin-3-yl]sulfanyl-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 160908370 |
| Molecular Formula | C23H33N5O6S |
| Molecular Weight | 507.61 g/mol |
| Exact Mass | 507.22 |
| IUPAC Name | (4R,5R,6R)-6-[(2S)-6-amino-4,6-dioxohexan-2-yl]-3-[(3S,5S)-5-[(3S)-3-aminopyrrolidine-1-carbonyl]pyrrolidin-3-yl]sulfanyl-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid |
| SMILES | C[C@@H](CC(=O)CC(N)=O)[C@H]1C(=O)N2C(C(=O)O)=C(S[C@@H]3CN[C@H](C(=O)N4CC[C@H](N)C4)C3)[C@H](C)[C@@H]12 |
| InChI | InChI=1S/C23H33N5O6S/c1-10(5-13(29)6-16(25)30)17-18-11(2)20(19(23(33)34)28(18)22(17)32)35-14-7-15(26-8-14)21(31)27-4-3-12(24)9-27/h10-12,14-15,17-18,26H,3-9,24H2,1-2H3,(H2,25,30)(H,33,34)/t10-,11+,12-,14-,15-,17+,18-/m0/s1 |
| InChIKey | SQLFDSGUICFLJF-ZKGFRCBASA-N |
| XLogP | -0.75 |
| TPSA | 176.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.61 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|