C59H75B2N5O17 — CID 160908593
CID 160908593 (PubChem CID 160908593) has the molecular formula C59H75B2N5O17 and a molecular weight of 1147.89 g/mol.
| Compound Name | CID 160908593 |
|---|---|
| PubChem CID | 160908593 |
| Molecular Formula | C59H75B2N5O17 |
| Molecular Weight | 1147.89 g/mol |
| Exact Mass | 1147.53 |
| IUPAC Name | — |
| SMILES | C.CC1OC(=O)c2c(O)cc(OCCCCc3ncc[nH]3)cc2/C=C/CC(O)C(O)C(=O)/C=C\[C@H]1C.COCOc1cc(OCCN([B]C=O)Cc2nccn2[B]C=O)cc2c1C(=O)OC(C)[C@H](C)/C=C\C(=O)C1OC(C)(C)OC1C/C=C/2 |
| InChI | InChI=1S/C32H39B2N3O10.C26H32N2O7.CH4/c1-21-9-10-25(40)30-26(46-32(3,4)47-30)8-6-7-23-15-24(16-27(44-20-42-5)29(23)31(41)45-22(21)2)43-14-13-36(33-18-38)17-28-35-11-12-37(28)34-19-39;1-16-9-10-21(30)25(32)20(29)7-5-6-18-14-19(15-22(31)24(18)26(33)35-17(16)2)34-13-4-3-8-23-27-11-12-28-23;/h6-7,9-12,15-16,18-19,21-22,26,30H,8,13-14,17,20H2,1-5H3;5-6,9-12,14-17,20,25,29,31-32H,3-4,7-8,13H2,1-2H3,(H,27,28);1H4/b7-6+,10-9-;6-5+,10-9-;/t21-,22?,26?,30?;16-,17?,20?,25?;/m11./s1 |
| InChIKey | JXEPLCXYKQYLQY-JZRRVIAHSA-N |
| XLogP | 6.06 |
| TPSA | 286.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 21 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 83 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1147.89 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 21 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|