About 2-amino-5-methylbenzoic acid;1-isocyanato-4-phenoxybenzene
2-amino-5-methylbenzoic acid;1-isocyanato-4-phenoxybenzene (PubChem CID 160908778) has the molecular formula C21H18N2O4
and a molecular weight of 362.39 g/mol. Its IUPAC name is 2-amino-5-methylbenzoic acid;1-isocyanato-4-phenoxybenzene.
Molecular Properties
| Compound Name | 2-amino-5-methylbenzoic acid;1-isocyanato-4-phenoxybenzene |
| PubChem CID | 160908778 |
| Molecular Formula | C21H18N2O4 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | 2-amino-5-methylbenzoic acid;1-isocyanato-4-phenoxybenzene |
| SMILES | Cc1ccc(N)c(C(=O)O)c1.O=C=Nc1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C13H9NO2.C8H9NO2/c15-10-14-11-6-8-13(9-7-11)16-12-4-2-1-3-5-12;1-5-2-3-7(9)6(4-5)8(10)11/h1-9H;2-4H,9H2,1H3,(H,10,11) |
| InChIKey | SQMNVURACUCZHX-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 101.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-5-methylbenzoic acid;1-isocyanato-4-phenoxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-5-methylbenzoic acid;1-isocyanato-4-phenoxybenzene?
The IUPAC name of 2-amino-5-methylbenzoic acid;1-isocyanato-4-phenoxybenzene (CID 160908778) is 2-amino-5-methylbenzoic acid;1-isocyanato-4-phenoxybenzene.
What is the SMILES notation for 2-amino-5-methylbenzoic acid;1-isocyanato-4-phenoxybenzene?
The canonical SMILES for 2-amino-5-methylbenzoic acid;1-isocyanato-4-phenoxybenzene is Cc1ccc(N)c(C(=O)O)c1.O=C=Nc1ccc(Oc2ccccc2)cc1.
What is the InChIKey of 2-amino-5-methylbenzoic acid;1-isocyanato-4-phenoxybenzene?
The InChIKey is SQMNVURACUCZHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9NO2.C8H9NO2/c15-10-14-11-6-8-13(9-7-11)16-12-4-2-1-3-5-12;1-5-2-3-7(9)6(4-5)8(10)11/h1-9H;2-4H,9H2,1H3,(H,10,11).
What are the key properties of 2-amino-5-methylbenzoic acid;1-isocyanato-4-phenoxybenzene?
2-amino-5-methylbenzoic acid;1-isocyanato-4-phenoxybenzene has a molecular weight of 362.39 g/mol, XLogP of 4.72, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-5-methylbenzoic acid;1-isocyanato-4-phenoxybenzene is sourced from PubChem (CID 160908778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).