C44H37F3N4O10S2 — CID 160910147
3-[[3-(1,3-benzothiazol-2-yl)-2-oxochromen-7-yl]amino]propanoic acid;tert-butyl 3-[[3-(1,3-benzothiazol-2-yl)-2-oxochromen-7-yl]amino]propanoate;2,2,2-trifluoroacetic acid (PubChem CID 160910147) has the molecular formula C44H37F3N4O10S2 and a molecular weight of 902.93 g/mol. Its IUPAC name is 3-[[3-(1,3-benzothiazol-2-yl)-2-oxochromen-7-yl]amino]propanoic acid;tert-butyl 3-[[3-(1,3-benzothiazol-2-yl)-2-oxochromen-7-yl]amino]propanoate;2,2,2-trifluoroacetic acid.
| Compound Name | 3-[[3-(1,3-benzothiazol-2-yl)-2-oxochromen-7-yl]amino]propanoic acid;tert-butyl 3-[[3-(1,3-benzothiazol-2-yl)-2-oxochromen-7-yl]amino]propanoate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 160910147 |
| Molecular Formula | C44H37F3N4O10S2 |
| Molecular Weight | 902.93 g/mol |
| Exact Mass | 902.19 |
| IUPAC Name | 3-[[3-(1,3-benzothiazol-2-yl)-2-oxochromen-7-yl]amino]propanoic acid;tert-butyl 3-[[3-(1,3-benzothiazol-2-yl)-2-oxochromen-7-yl]amino]propanoate;2,2,2-trifluoroacetic acid |
| SMILES | CC(C)(C)OC(=O)CCNc1ccc2cc(-c3nc4ccccc4s3)c(=O)oc2c1.O=C(O)C(F)(F)F.O=C(O)CCNc1ccc2cc(-c3nc4ccccc4s3)c(=O)oc2c1 |
| InChI | InChI=1S/C23H22N2O4S.C19H14N2O4S.C2HF3O2/c1-23(2,3)29-20(26)10-11-24-15-9-8-14-12-16(22(27)28-18(14)13-15)21-25-17-6-4-5-7-19(17)30-21;22-17(23)7-8-20-12-6-5-11-9-13(19(24)25-15(11)10-12)18-21-14-3-1-2-4-16(14)26-18;3-2(4,5)1(6)7/h4-9,12-13,24H,10-11H2,1-3H3;1-6,9-10,20H,7-8H2,(H,22,23);(H,6,7) |
| InChIKey | XMAVTSJSQDFBPB-UHFFFAOYSA-N |
| XLogP | 9.80 |
| TPSA | 211.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 63 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 902.93 |
| LogP ≤ 5 | 9.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|