C25H15F6NO3P- — CID 160910762
3-(8,14-dioxa-22-azahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2,4,6,9(21),10,12,15,17,19-nonaen-22-yl)phenol hexafluorophosphate (PubChem CID 160910762) has the molecular formula C25H15F6NO3P- and a molecular weight of 522.36 g/mol. Its IUPAC name is 3-(8,14-dioxa-22-azahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2,4,6,9(21),10,12,15,17,19-nonaen-22-yl)phenol hexafluorophosphate.
| Compound Name | 3-(8,14-dioxa-22-azahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2,4,6,9(21),10,12,15,17,19-nonaen-22-yl)phenol hexafluorophosphate |
|---|---|
| PubChem CID | 160910762 |
| Molecular Formula | C25H15F6NO3P- |
| Molecular Weight | 522.36 g/mol |
| Exact Mass | 522.07 |
| IUPAC Name | 3-(8,14-dioxa-22-azahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2,4,6,9(21),10,12,15,17,19-nonaen-22-yl)phenol hexafluorophosphate |
| SMILES | F[P-](F)(F)(F)(F)F.Oc1cccc(N2c3cccc4c3C3c5c(cccc5Oc5cccc2c53)O4)c1 |
| InChI | InChI=1S/C25H15NO3.F6P/c27-15-6-1-5-14(13-15)26-16-7-2-9-18-22(16)25-23-17(26)8-3-10-19(23)29-21-12-4-11-20(28-18)24(21)25;1-7(2,3,4,5)6/h1-13,25,27H;/q;-1 |
| InChIKey | ZFCXMAFDJFGTDU-UHFFFAOYSA-N |
| XLogP | 9.95 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.36 |
| LogP ≤ 5 | 9.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|