About 5-bromo-1H-isoindole;tert-butyl 5-bromo-3-iodoindazole-1-carboxylate
5-bromo-1H-isoindole;tert-butyl 5-bromo-3-iodoindazole-1-carboxylate (PubChem CID 160911160) has the molecular formula C20H18Br2IN3O2
and a molecular weight of 619.10 g/mol. Its IUPAC name is 5-bromo-1H-isoindole;tert-butyl 5-bromo-3-iodoindazole-1-carboxylate.
Molecular Properties
| Compound Name | 5-bromo-1H-isoindole;tert-butyl 5-bromo-3-iodoindazole-1-carboxylate |
| PubChem CID | 160911160 |
| Molecular Formula | C20H18Br2IN3O2 |
| Molecular Weight | 619.10 g/mol |
| Exact Mass | 616.88 |
| IUPAC Name | 5-bromo-1H-isoindole;tert-butyl 5-bromo-3-iodoindazole-1-carboxylate |
| SMILES | Brc1ccc2c(c1)C=NC2.CC(C)(C)OC(=O)n1nc(I)c2cc(Br)ccc21 |
| InChI | InChI=1S/C12H12BrIN2O2.C8H6BrN/c1-12(2,3)18-11(17)16-9-5-4-7(13)6-8(9)10(14)15-16;9-8-2-1-6-4-10-5-7(6)3-8/h4-6H,1-3H3;1-3,5H,4H2 |
| InChIKey | SQUKWTVENALPDW-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 56.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 619.10 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-1H-isoindole;tert-butyl 5-bromo-3-iodoindazole-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-1H-isoindole;tert-butyl 5-bromo-3-iodoindazole-1-carboxylate?
The IUPAC name of 5-bromo-1H-isoindole;tert-butyl 5-bromo-3-iodoindazole-1-carboxylate (CID 160911160) is 5-bromo-1H-isoindole;tert-butyl 5-bromo-3-iodoindazole-1-carboxylate.
What is the SMILES notation for 5-bromo-1H-isoindole;tert-butyl 5-bromo-3-iodoindazole-1-carboxylate?
The canonical SMILES for 5-bromo-1H-isoindole;tert-butyl 5-bromo-3-iodoindazole-1-carboxylate is Brc1ccc2c(c1)C=NC2.CC(C)(C)OC(=O)n1nc(I)c2cc(Br)ccc21.
What is the InChIKey of 5-bromo-1H-isoindole;tert-butyl 5-bromo-3-iodoindazole-1-carboxylate?
The InChIKey is SQUKWTVENALPDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12BrIN2O2.C8H6BrN/c1-12(2,3)18-11(17)16-9-5-4-7(13)6-8(9)10(14)15-16;9-8-2-1-6-4-10-5-7(6)3-8/h4-6H,1-3H3;1-3,5H,4H2.
What are the key properties of 5-bromo-1H-isoindole;tert-butyl 5-bromo-3-iodoindazole-1-carboxylate?
5-bromo-1H-isoindole;tert-butyl 5-bromo-3-iodoindazole-1-carboxylate has a molecular weight of 619.10 g/mol, XLogP of 6.57, 0 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-1H-isoindole;tert-butyl 5-bromo-3-iodoindazole-1-carboxylate is sourced from PubChem (CID 160911160), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).