C27H31N3O3 — CID 160911173
methyl 4-[1-[2-[(1-cyclopentylcyclopentyl)amino]-2-oxoethyl]benzimidazol-2-yl]benzoate (PubChem CID 160911173) has the molecular formula C27H31N3O3 and a molecular weight of 445.56 g/mol. Its IUPAC name is methyl 4-[1-[2-[(1-cyclopentylcyclopentyl)amino]-2-oxoethyl]benzimidazol-2-yl]benzoate.
| Compound Name | methyl 4-[1-[2-[(1-cyclopentylcyclopentyl)amino]-2-oxoethyl]benzimidazol-2-yl]benzoate |
|---|---|
| PubChem CID | 160911173 |
| Molecular Formula | C27H31N3O3 |
| Molecular Weight | 445.56 g/mol |
| Exact Mass | 445.24 |
| IUPAC Name | methyl 4-[1-[2-[(1-cyclopentylcyclopentyl)amino]-2-oxoethyl]benzimidazol-2-yl]benzoate |
| SMILES | COC(=O)c1ccc(-c2nc3ccccc3n2CC(=O)NC2(C3CCCC3)CCCC2)cc1 |
| InChI | InChI=1S/C27H31N3O3/c1-33-26(32)20-14-12-19(13-15-20)25-28-22-10-4-5-11-23(22)30(25)18-24(31)29-27(16-6-7-17-27)21-8-2-3-9-21/h4-5,10-15,21H,2-3,6-9,16-18H2,1H3,(H,29,31) |
| InChIKey | SQUMBIDHHAKTRV-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.56 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |